C16H14N4S — CID 703940
12-(4-propan-2-ylphenyl)-10-thia-3,4,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene (PubChem CID 703940) has the molecular formula C16H14N4S and a molecular weight of 294.38 g/mol. Its IUPAC name is 12-(4-propan-2-ylphenyl)-10-thia-3,4,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene.
| Compound Name | 12-(4-propan-2-ylphenyl)-10-thia-3,4,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene |
|---|---|
| PubChem CID | 703940 |
| Molecular Formula | C16H14N4S |
| Molecular Weight | 294.38 g/mol |
| Exact Mass | 294.09 |
| IUPAC Name | 12-(4-propan-2-ylphenyl)-10-thia-3,4,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene |
| SMILES | CC(C)c1ccc(-c2csc3ncn4cnnc4c23)cc1 |
| InChI | InChI=1S/C16H14N4S/c1-10(2)11-3-5-12(6-4-11)13-7-21-16-14(13)15-19-18-9-20(15)8-17-16/h3-10H,1-2H3 |
| InChIKey | XFBGTUBMHUWLLG-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 43.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.38 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |