C43H37NO11 — CID 70394077
benzyl (2R,3R,4R,5S,6R)-3,4,5-tribenzoyloxy-2-(benzoyloxymethyl)-6-(hydroxymethyl)piperidine-1-carboxylate (PubChem CID 70394077) has the molecular formula C43H37NO11 and a molecular weight of 743.77 g/mol. Its IUPAC name is benzyl (2R,3R,4R,5S,6R)-3,4,5-tribenzoyloxy-2-(benzoyloxymethyl)-6-(hydroxymethyl)piperidine-1-carboxylate.
| Compound Name | benzyl (2R,3R,4R,5S,6R)-3,4,5-tribenzoyloxy-2-(benzoyloxymethyl)-6-(hydroxymethyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 70394077 |
| Molecular Formula | C43H37NO11 |
| Molecular Weight | 743.77 g/mol |
| Exact Mass | 743.24 |
| IUPAC Name | benzyl (2R,3R,4R,5S,6R)-3,4,5-tribenzoyloxy-2-(benzoyloxymethyl)-6-(hydroxymethyl)piperidine-1-carboxylate |
| SMILES | O=C(OC[C@@H]1[C@@H](OC(=O)c2ccccc2)[C@H](OC(=O)c2ccccc2)[C@@H](OC(=O)c2ccccc2)[C@@H](CO)N1C(=O)OCc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C43H37NO11/c45-26-34-36(53-40(47)31-20-10-3-11-21-31)38(55-42(49)33-24-14-5-15-25-33)37(54-41(48)32-22-12-4-13-23-32)35(28-51-39(46)30-18-8-2-9-19-30)44(34)43(50)52-27-29-16-6-1-7-17-29/h1-25,34-38,45H,26-28H2/t34-,35-,36+,37-,38-/m1/s1 |
| InChIKey | LJDXCHOUULTBKR-JTDOPDNRSA-N |
| XLogP | 5.90 |
| TPSA | 154.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 55 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 743.77 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|