C13H18N2O3 — CID 70394348
3a,4,7,7a-tetrahydroisoindole-1,3-dione;2-ethyl-4,5-dihydro-1,3-oxazole (PubChem CID 70394348) has the molecular formula C13H18N2O3 and a molecular weight of 250.30 g/mol. Its IUPAC name is 3a,4,7,7a-tetrahydroisoindole-1,3-dione;2-ethyl-4,5-dihydro-1,3-oxazole.
| Compound Name | 3a,4,7,7a-tetrahydroisoindole-1,3-dione;2-ethyl-4,5-dihydro-1,3-oxazole |
|---|---|
| PubChem CID | 70394348 |
| Molecular Formula | C13H18N2O3 |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.13 |
| IUPAC Name | 3a,4,7,7a-tetrahydroisoindole-1,3-dione;2-ethyl-4,5-dihydro-1,3-oxazole |
| SMILES | CCC1=NCCO1.O=C1NC(=O)C2CC=CCC12 |
| InChI | InChI=1S/C8H9NO2.C5H9NO/c10-7-5-3-1-2-4-6(5)8(11)9-7;1-2-5-6-3-4-7-5/h1-2,5-6H,3-4H2,(H,9,10,11);2-4H2,1H3 |
| InChIKey | DGVYASXIOISYIC-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|