About 2-[(E)-2-[2-(3,4-dichlorobutoxy)phenyl]ethenyl]-1,3-benzoxazole
2-[(E)-2-[2-(3,4-dichlorobutoxy)phenyl]ethenyl]-1,3-benzoxazole (PubChem CID 70394658) has the molecular formula C19H17Cl2NO2
and a molecular weight of 362.26 g/mol. Its IUPAC name is 2-[(E)-2-[2-(3,4-dichlorobutoxy)phenyl]ethenyl]-1,3-benzoxazole.
Molecular Properties
| Compound Name | 2-[(E)-2-[2-(3,4-dichlorobutoxy)phenyl]ethenyl]-1,3-benzoxazole |
| PubChem CID | 70394658 |
| Molecular Formula | C19H17Cl2NO2 |
| Molecular Weight | 362.26 g/mol |
| Exact Mass | 361.06 |
| IUPAC Name | 2-[(E)-2-[2-(3,4-dichlorobutoxy)phenyl]ethenyl]-1,3-benzoxazole |
| SMILES | ClCC(Cl)CCOc1ccccc1/C=C/c1nc2ccccc2o1 |
| InChI | InChI=1S/C19H17Cl2NO2/c20-13-15(21)11-12-23-17-7-3-1-5-14(17)9-10-19-22-16-6-2-4-8-18(16)24-19/h1-10,15H,11-13H2/b10-9+ |
| InChIKey | IJHXTNVIYHZFCW-MDZDMXLPSA-N |
| XLogP | 5.61 |
| TPSA | 35.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 362.26 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-[(E)-2-[2-(3,4-dichlorobutoxy)phenyl]ethenyl]-1,3-benzoxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(E)-2-[2-(3,4-dichlorobutoxy)phenyl]ethenyl]-1,3-benzoxazole?
The IUPAC name of 2-[(E)-2-[2-(3,4-dichlorobutoxy)phenyl]ethenyl]-1,3-benzoxazole (CID 70394658) is 2-[(E)-2-[2-(3,4-dichlorobutoxy)phenyl]ethenyl]-1,3-benzoxazole.
What is the SMILES notation for 2-[(E)-2-[2-(3,4-dichlorobutoxy)phenyl]ethenyl]-1,3-benzoxazole?
The canonical SMILES for 2-[(E)-2-[2-(3,4-dichlorobutoxy)phenyl]ethenyl]-1,3-benzoxazole is ClCC(Cl)CCOc1ccccc1/C=C/c1nc2ccccc2o1.
What is the InChIKey of 2-[(E)-2-[2-(3,4-dichlorobutoxy)phenyl]ethenyl]-1,3-benzoxazole?
The InChIKey is IJHXTNVIYHZFCW-MDZDMXLPSA-N. The full InChI is InChI=1S/C19H17Cl2NO2/c20-13-15(21)11-12-23-17-7-3-1-5-14(17)9-10-19-22-16-6-2-4-8-18(16)24-19/h1-10,15H,11-13H2/b10-9+.
What are the key properties of 2-[(E)-2-[2-(3,4-dichlorobutoxy)phenyl]ethenyl]-1,3-benzoxazole?
2-[(E)-2-[2-(3,4-dichlorobutoxy)phenyl]ethenyl]-1,3-benzoxazole has a molecular weight of 362.26 g/mol, XLogP of 5.61, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(E)-2-[2-(3,4-dichlorobutoxy)phenyl]ethenyl]-1,3-benzoxazole is sourced from PubChem (CID 70394658), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).