C24H31ClN4O3 — CID 70394700
4-[[2-ethyl-3-[(3,4,5-trimethoxyphenyl)methyl]imidazol-3-ium-1-yl]iminomethyl]-N,N-dimethylaniline chloride (PubChem CID 70394700) has the molecular formula C24H31ClN4O3 and a molecular weight of 458.99 g/mol. Its IUPAC name is 4-[[2-ethyl-3-[(3,4,5-trimethoxyphenyl)methyl]imidazol-3-ium-1-yl]iminomethyl]-N,N-dimethylaniline chloride.
| Compound Name | 4-[[2-ethyl-3-[(3,4,5-trimethoxyphenyl)methyl]imidazol-3-ium-1-yl]iminomethyl]-N,N-dimethylaniline chloride |
|---|---|
| PubChem CID | 70394700 |
| Molecular Formula | C24H31ClN4O3 |
| Molecular Weight | 458.99 g/mol |
| Exact Mass | 458.21 |
| IUPAC Name | 4-[[2-ethyl-3-[(3,4,5-trimethoxyphenyl)methyl]imidazol-3-ium-1-yl]iminomethyl]-N,N-dimethylaniline chloride |
| SMILES | CCc1n(N=Cc2ccc(N(C)C)cc2)cc[n+]1Cc1cc(OC)c(OC)c(OC)c1.[Cl-] |
| InChI | InChI=1S/C24H31N4O3.ClH/c1-7-23-27(17-19-14-21(29-4)24(31-6)22(15-19)30-5)12-13-28(23)25-16-18-8-10-20(11-9-18)26(2)3;/h8-16H,7,17H2,1-6H3;1H/q+1;/p-1 |
| InChIKey | IDGSCWYFIDDBPQ-UHFFFAOYSA-M |
| XLogP | 0.36 |
| TPSA | 52.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.99 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|