C12H12O10 — CID 70394725
2-hydroxycyclohexa-2,5-diene-1,4-dione;2-hydroxypropane-1,2,3-tricarboxylic acid (PubChem CID 70394725) has the molecular formula C12H12O10 and a molecular weight of 316.22 g/mol. Its IUPAC name is 2-hydroxycyclohexa-2,5-diene-1,4-dione;2-hydroxypropane-1,2,3-tricarboxylic acid.
| Compound Name | 2-hydroxycyclohexa-2,5-diene-1,4-dione;2-hydroxypropane-1,2,3-tricarboxylic acid |
|---|---|
| PubChem CID | 70394725 |
| Molecular Formula | C12H12O10 |
| Molecular Weight | 316.22 g/mol |
| Exact Mass | 316.04 |
| IUPAC Name | 2-hydroxycyclohexa-2,5-diene-1,4-dione;2-hydroxypropane-1,2,3-tricarboxylic acid |
| SMILES | O=C(O)CC(O)(CC(=O)O)C(=O)O.O=C1C=CC(=O)C(O)=C1 |
| InChI | InChI=1S/C6H8O7.C6H4O3/c7-3(8)1-6(13,5(11)12)2-4(9)10;7-4-1-2-5(8)6(9)3-4/h13H,1-2H2,(H,7,8)(H,9,10)(H,11,12);1-3,9H |
| InChIKey | IRFDWPBGUSLZEY-UHFFFAOYSA-N |
| XLogP | -1.11 |
| TPSA | 186.50 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.22 |
| LogP ≤ 5 | -1.11 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|