3,7-dichloroquinoline-8-carboxylic acid;hydrochloride

C10H6Cl3NO2 — CID 70394889

IUPAC3,7-dichloroquinoline-8-carboxylic acid;hydrochloride
SMILESCl.O=C(O)c1c(Cl)ccc2cc(Cl)cnc12
InChIInChI=1S/C10H5Cl2NO2.ClH/c11-6-3-5-1-2-7(12)8(10(14)15)9(5)13-4-6;/h1-4H,(H,14,15);1H
InChIKeyRBYONTLXBDMNFW-UHFFFAOYSA-N
MW278.52 g/mol
LogP3.66
Rot. Bonds1

About 3,7-dichloroquinoline-8-carboxylic acid;hydrochloride

3,7-dichloroquinoline-8-carboxylic acid;hydrochloride (PubChem CID 70394889) has the molecular formula C10H6Cl3NO2 and a molecular weight of 278.52 g/mol. Its IUPAC name is 3,7-dichloroquinoline-8-carboxylic acid;hydrochloride.

Molecular Properties

Compound Name3,7-dichloroquinoline-8-carboxylic acid;hydrochloride
PubChem CID70394889
Molecular FormulaC10H6Cl3NO2
Molecular Weight278.52 g/mol
Exact Mass276.95
IUPAC Name3,7-dichloroquinoline-8-carboxylic acid;hydrochloride
SMILESCl.O=C(O)c1c(Cl)ccc2cc(Cl)cnc12
InChIInChI=1S/C10H5Cl2NO2.ClH/c11-6-3-5-1-2-7(12)8(10(14)15)9(5)13-4-6;/h1-4H,(H,14,15);1H
InChIKeyRBYONTLXBDMNFW-UHFFFAOYSA-N
XLogP3.66
TPSA50.19 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500278.52
LogP ≤ 53.66
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 3,7-dichloroquinoline-8-carboxylic acid;hydrochloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3,7-dichloroquinoline-8-carboxylic acid;hydrochloride?
The IUPAC name of 3,7-dichloroquinoline-8-carboxylic acid;hydrochloride (CID 70394889) is 3,7-dichloroquinoline-8-carboxylic acid;hydrochloride.
What is the SMILES notation for 3,7-dichloroquinoline-8-carboxylic acid;hydrochloride?
The canonical SMILES for 3,7-dichloroquinoline-8-carboxylic acid;hydrochloride is Cl.O=C(O)c1c(Cl)ccc2cc(Cl)cnc12.
What is the InChIKey of 3,7-dichloroquinoline-8-carboxylic acid;hydrochloride?
The InChIKey is RBYONTLXBDMNFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H5Cl2NO2.ClH/c11-6-3-5-1-2-7(12)8(10(14)15)9(5)13-4-6;/h1-4H,(H,14,15);1H.
What are the key properties of 3,7-dichloroquinoline-8-carboxylic acid;hydrochloride?
3,7-dichloroquinoline-8-carboxylic acid;hydrochloride has a molecular weight of 278.52 g/mol, XLogP of 3.66, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,7-dichloroquinoline-8-carboxylic acid;hydrochloride is sourced from PubChem (CID 70394889), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).