C19H28Cl3N5S — CID 70394949
1-ethyl-4-(4-methylphenyl)piperazine;2H-[1,2,4]triazolo[4,3-a]pyridine-3-thione;trihydrochloride (PubChem CID 70394949) has the molecular formula C19H28Cl3N5S and a molecular weight of 464.89 g/mol. Its IUPAC name is 1-ethyl-4-(4-methylphenyl)piperazine;2H-[1,2,4]triazolo[4,3-a]pyridine-3-thione;trihydrochloride.
| Compound Name | 1-ethyl-4-(4-methylphenyl)piperazine;2H-[1,2,4]triazolo[4,3-a]pyridine-3-thione;trihydrochloride |
|---|---|
| PubChem CID | 70394949 |
| Molecular Formula | C19H28Cl3N5S |
| Molecular Weight | 464.89 g/mol |
| Exact Mass | 463.11 |
| IUPAC Name | 1-ethyl-4-(4-methylphenyl)piperazine;2H-[1,2,4]triazolo[4,3-a]pyridine-3-thione;trihydrochloride |
| SMILES | CCN1CCN(c2ccc(C)cc2)CC1.Cl.Cl.Cl.S=c1[nH]nc2ccccn12 |
| InChI | InChI=1S/C13H20N2.C6H5N3S.3ClH/c1-3-14-8-10-15(11-9-14)13-6-4-12(2)5-7-13;10-6-8-7-5-3-1-2-4-9(5)6;;;/h4-7H,3,8-11H2,1-2H3;1-4H,(H,8,10);3*1H |
| InChIKey | LLNHRGQAGMZGLO-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 39.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.89 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|