About dodecan-4-yl 2-[4-[4-(1-methoxyethyl)phenyl]phenyl]benzoate
dodecan-4-yl 2-[4-[4-(1-methoxyethyl)phenyl]phenyl]benzoate (PubChem CID 70395586) has the molecular formula C34H44O3
and a molecular weight of 500.72 g/mol. Its IUPAC name is dodecan-4-yl 2-[4-[4-(1-methoxyethyl)phenyl]phenyl]benzoate.
Molecular Properties
| Compound Name | dodecan-4-yl 2-[4-[4-(1-methoxyethyl)phenyl]phenyl]benzoate |
| PubChem CID | 70395586 |
| Molecular Formula | C34H44O3 |
| Molecular Weight | 500.72 g/mol |
| Exact Mass | 500.33 |
| IUPAC Name | dodecan-4-yl 2-[4-[4-(1-methoxyethyl)phenyl]phenyl]benzoate |
| SMILES | CCCCCCCCC(CCC)OC(=O)c1ccccc1-c1ccc(-c2ccc(C(C)OC)cc2)cc1 |
| InChI | InChI=1S/C34H44O3/c1-5-7-8-9-10-11-15-31(14-6-2)37-34(35)33-17-13-12-16-32(33)30-24-22-29(23-25-30)28-20-18-27(19-21-28)26(3)36-4/h12-13,16-26,31H,5-11,14-15H2,1-4H3 |
| InChIKey | UZFLVFYFSWKWCC-UHFFFAOYSA-N |
| XLogP | 9.80 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 500.72 |
| LogP ≤ 5 | 9.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze dodecan-4-yl 2-[4-[4-(1-methoxyethyl)phenyl]phenyl]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dodecan-4-yl 2-[4-[4-(1-methoxyethyl)phenyl]phenyl]benzoate?
The IUPAC name of dodecan-4-yl 2-[4-[4-(1-methoxyethyl)phenyl]phenyl]benzoate (CID 70395586) is dodecan-4-yl 2-[4-[4-(1-methoxyethyl)phenyl]phenyl]benzoate.
What is the SMILES notation for dodecan-4-yl 2-[4-[4-(1-methoxyethyl)phenyl]phenyl]benzoate?
The canonical SMILES for dodecan-4-yl 2-[4-[4-(1-methoxyethyl)phenyl]phenyl]benzoate is CCCCCCCCC(CCC)OC(=O)c1ccccc1-c1ccc(-c2ccc(C(C)OC)cc2)cc1.
What is the InChIKey of dodecan-4-yl 2-[4-[4-(1-methoxyethyl)phenyl]phenyl]benzoate?
The InChIKey is UZFLVFYFSWKWCC-UHFFFAOYSA-N. The full InChI is InChI=1S/C34H44O3/c1-5-7-8-9-10-11-15-31(14-6-2)37-34(35)33-17-13-12-16-32(33)30-24-22-29(23-25-30)28-20-18-27(19-21-28)26(3)36-4/h12-13,16-26,31H,5-11,14-15H2,1-4H3.
What are the key properties of dodecan-4-yl 2-[4-[4-(1-methoxyethyl)phenyl]phenyl]benzoate?
dodecan-4-yl 2-[4-[4-(1-methoxyethyl)phenyl]phenyl]benzoate has a molecular weight of 500.72 g/mol, XLogP of 9.80, 15 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for dodecan-4-yl 2-[4-[4-(1-methoxyethyl)phenyl]phenyl]benzoate is sourced from PubChem (CID 70395586), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).