C18H26O3 — CID 70395765
(1-hydroxy-2,2-dimethylpropyl) 2,3-di(cyclopenten-1-yl)prop-2-enoate (PubChem CID 70395765) has the molecular formula C18H26O3 and a molecular weight of 290.40 g/mol. Its IUPAC name is (1-hydroxy-2,2-dimethylpropyl) 2,3-di(cyclopenten-1-yl)prop-2-enoate.
| Compound Name | (1-hydroxy-2,2-dimethylpropyl) 2,3-di(cyclopenten-1-yl)prop-2-enoate |
|---|---|
| PubChem CID | 70395765 |
| Molecular Formula | C18H26O3 |
| Molecular Weight | 290.40 g/mol |
| Exact Mass | 290.19 |
| IUPAC Name | (1-hydroxy-2,2-dimethylpropyl) 2,3-di(cyclopenten-1-yl)prop-2-enoate |
| SMILES | CC(C)(C)C(O)OC(=O)C(=CC1=CCCC1)C1=CCCC1 |
| InChI | InChI=1S/C18H26O3/c1-18(2,3)17(20)21-16(19)15(14-10-6-7-11-14)12-13-8-4-5-9-13/h8,10,12,17,20H,4-7,9,11H2,1-3H3 |
| InChIKey | YFGHYODTSMZEJO-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.40 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|