C24H26N5O4P — CID 70395886
6-phenylmethoxy-9-[1-(2-phenylmethoxy-1,3,2-dioxaphosphinan-5-yl)ethyl]purin-2-amine (PubChem CID 70395886) has the molecular formula C24H26N5O4P and a molecular weight of 479.48 g/mol. Its IUPAC name is 6-phenylmethoxy-9-[1-(2-phenylmethoxy-1,3,2-dioxaphosphinan-5-yl)ethyl]purin-2-amine.
| Compound Name | 6-phenylmethoxy-9-[1-(2-phenylmethoxy-1,3,2-dioxaphosphinan-5-yl)ethyl]purin-2-amine |
|---|---|
| PubChem CID | 70395886 |
| Molecular Formula | C24H26N5O4P |
| Molecular Weight | 479.48 g/mol |
| Exact Mass | 479.17 |
| IUPAC Name | 6-phenylmethoxy-9-[1-(2-phenylmethoxy-1,3,2-dioxaphosphinan-5-yl)ethyl]purin-2-amine |
| SMILES | CC(C1COP(OCc2ccccc2)OC1)n1cnc2c(OCc3ccccc3)nc(N)nc21 |
| InChI | InChI=1S/C24H26N5O4P/c1-17(20-14-32-34(33-15-20)31-13-19-10-6-3-7-11-19)29-16-26-21-22(29)27-24(25)28-23(21)30-12-18-8-4-2-5-9-18/h2-11,16-17,20H,12-15H2,1H3,(H2,25,27,28) |
| InChIKey | LFYIXSINYVQUSE-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 106.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.48 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|