C9H8N4S — CID 703960
4-methyl-2H-[1,2,4]triazolo[4,3-a]benzimidazole-1-thione (PubChem CID 703960) has the molecular formula C9H8N4S and a molecular weight of 204.26 g/mol. Its IUPAC name is 4-methyl-2H-[1,2,4]triazolo[4,3-a]benzimidazole-1-thione.
| Compound Name | 4-methyl-2H-[1,2,4]triazolo[4,3-a]benzimidazole-1-thione |
|---|---|
| PubChem CID | 703960 |
| Molecular Formula | C9H8N4S |
| Molecular Weight | 204.26 g/mol |
| Exact Mass | 204.05 |
| IUPAC Name | 4-methyl-2H-[1,2,4]triazolo[4,3-a]benzimidazole-1-thione |
| SMILES | Cn1c2ccccc2n2c(=S)[nH]nc12 |
| InChI | InChI=1S/C9H8N4S/c1-12-6-4-2-3-5-7(6)13-8(12)10-11-9(13)14/h2-5H,1H3,(H,11,14) |
| InChIKey | KKRXWMLLDAIWCO-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 38.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.26 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|