About tert-butyl [(4R)-4-(2-fluoro-3-hydroxyprop-1-enyl)-2,2-dimethyl-1,3-oxazolidin-3-yl] carbonate
tert-butyl [(4R)-4-(2-fluoro-3-hydroxyprop-1-enyl)-2,2-dimethyl-1,3-oxazolidin-3-yl] carbonate (PubChem CID 70396133) has the molecular formula C13H22FNO5
and a molecular weight of 291.32 g/mol. Its IUPAC name is tert-butyl [(4R)-4-(2-fluoro-3-hydroxyprop-1-enyl)-2,2-dimethyl-1,3-oxazolidin-3-yl] carbonate.
Molecular Properties
| Compound Name | tert-butyl [(4R)-4-(2-fluoro-3-hydroxyprop-1-enyl)-2,2-dimethyl-1,3-oxazolidin-3-yl] carbonate |
| PubChem CID | 70396133 |
| Molecular Formula | C13H22FNO5 |
| Molecular Weight | 291.32 g/mol |
| Exact Mass | 291.15 |
| IUPAC Name | tert-butyl [(4R)-4-(2-fluoro-3-hydroxyprop-1-enyl)-2,2-dimethyl-1,3-oxazolidin-3-yl] carbonate |
| SMILES | CC(C)(C)OC(=O)ON1[C@H](C=C(F)CO)COC1(C)C |
| InChI | InChI=1S/C13H22FNO5/c1-12(2,3)19-11(17)20-15-10(6-9(14)7-16)8-18-13(15,4)5/h6,10,16H,7-8H2,1-5H3/t10-/m1/s1 |
| InChIKey | PDIGLYULLBAWJG-SNVBAGLBSA-N |
| XLogP | 2.14 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.32 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze tert-butyl [(4R)-4-(2-fluoro-3-hydroxyprop-1-enyl)-2,2-dimethyl-1,3-oxazolidin-3-yl] carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl [(4R)-4-(2-fluoro-3-hydroxyprop-1-enyl)-2,2-dimethyl-1,3-oxazolidin-3-yl] carbonate?
The IUPAC name of tert-butyl [(4R)-4-(2-fluoro-3-hydroxyprop-1-enyl)-2,2-dimethyl-1,3-oxazolidin-3-yl] carbonate (CID 70396133) is tert-butyl [(4R)-4-(2-fluoro-3-hydroxyprop-1-enyl)-2,2-dimethyl-1,3-oxazolidin-3-yl] carbonate.
What is the SMILES notation for tert-butyl [(4R)-4-(2-fluoro-3-hydroxyprop-1-enyl)-2,2-dimethyl-1,3-oxazolidin-3-yl] carbonate?
The canonical SMILES for tert-butyl [(4R)-4-(2-fluoro-3-hydroxyprop-1-enyl)-2,2-dimethyl-1,3-oxazolidin-3-yl] carbonate is CC(C)(C)OC(=O)ON1[C@H](C=C(F)CO)COC1(C)C.
What is the InChIKey of tert-butyl [(4R)-4-(2-fluoro-3-hydroxyprop-1-enyl)-2,2-dimethyl-1,3-oxazolidin-3-yl] carbonate?
The InChIKey is PDIGLYULLBAWJG-SNVBAGLBSA-N. The full InChI is InChI=1S/C13H22FNO5/c1-12(2,3)19-11(17)20-15-10(6-9(14)7-16)8-18-13(15,4)5/h6,10,16H,7-8H2,1-5H3/t10-/m1/s1.
What are the key properties of tert-butyl [(4R)-4-(2-fluoro-3-hydroxyprop-1-enyl)-2,2-dimethyl-1,3-oxazolidin-3-yl] carbonate?
tert-butyl [(4R)-4-(2-fluoro-3-hydroxyprop-1-enyl)-2,2-dimethyl-1,3-oxazolidin-3-yl] carbonate has a molecular weight of 291.32 g/mol, XLogP of 2.14, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl [(4R)-4-(2-fluoro-3-hydroxyprop-1-enyl)-2,2-dimethyl-1,3-oxazolidin-3-yl] carbonate is sourced from PubChem (CID 70396133), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).