About 3-(4,5-dihydro-1H-imidazol-2-yl)heptadecan-1-ol
3-(4,5-dihydro-1H-imidazol-2-yl)heptadecan-1-ol (PubChem CID 70396143) has the molecular formula C20H40N2O
and a molecular weight of 324.55 g/mol. Its IUPAC name is 3-(4,5-dihydro-1H-imidazol-2-yl)heptadecan-1-ol.
Molecular Properties
| Compound Name | 3-(4,5-dihydro-1H-imidazol-2-yl)heptadecan-1-ol |
| PubChem CID | 70396143 |
| Molecular Formula | C20H40N2O |
| Molecular Weight | 324.55 g/mol |
| Exact Mass | 324.31 |
| IUPAC Name | 3-(4,5-dihydro-1H-imidazol-2-yl)heptadecan-1-ol |
| SMILES | CCCCCCCCCCCCCCC(CCO)C1=NCCN1 |
| InChI | InChI=1S/C20H40N2O/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-19(15-18-23)20-21-16-17-22-20/h19,23H,2-18H2,1H3,(H,21,22) |
| InChIKey | OVWPCKAIQCJGKR-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 44.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 324.55 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-(4,5-dihydro-1H-imidazol-2-yl)heptadecan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4,5-dihydro-1H-imidazol-2-yl)heptadecan-1-ol?
The IUPAC name of 3-(4,5-dihydro-1H-imidazol-2-yl)heptadecan-1-ol (CID 70396143) is 3-(4,5-dihydro-1H-imidazol-2-yl)heptadecan-1-ol.
What is the SMILES notation for 3-(4,5-dihydro-1H-imidazol-2-yl)heptadecan-1-ol?
The canonical SMILES for 3-(4,5-dihydro-1H-imidazol-2-yl)heptadecan-1-ol is CCCCCCCCCCCCCCC(CCO)C1=NCCN1.
What is the InChIKey of 3-(4,5-dihydro-1H-imidazol-2-yl)heptadecan-1-ol?
The InChIKey is OVWPCKAIQCJGKR-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H40N2O/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-19(15-18-23)20-21-16-17-22-20/h19,23H,2-18H2,1H3,(H,21,22).
What are the key properties of 3-(4,5-dihydro-1H-imidazol-2-yl)heptadecan-1-ol?
3-(4,5-dihydro-1H-imidazol-2-yl)heptadecan-1-ol has a molecular weight of 324.55 g/mol, XLogP of 5.08, 16 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4,5-dihydro-1H-imidazol-2-yl)heptadecan-1-ol is sourced from PubChem (CID 70396143), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).