About 3,4-dihydro-1H-2,5,1-benzodioxazepine
3,4-dihydro-1H-2,5,1-benzodioxazepine (PubChem CID 70396307) has the molecular formula C8H9NO2
and a molecular weight of 151.16 g/mol. Its IUPAC name is 3,4-dihydro-1H-2,5,1-benzodioxazepine.
Molecular Properties
| Compound Name | 3,4-dihydro-1H-2,5,1-benzodioxazepine |
| PubChem CID | 70396307 |
| Molecular Formula | C8H9NO2 |
| Molecular Weight | 151.16 g/mol |
| Exact Mass | 151.06 |
| IUPAC Name | 3,4-dihydro-1H-2,5,1-benzodioxazepine |
| SMILES | c1ccc2c(c1)NOCCO2 |
| InChI | InChI=1S/C8H9NO2/c1-2-4-8-7(3-1)9-11-6-5-10-8/h1-4,9H,5-6H2 |
| InChIKey | VXYKQGLCIKMBSP-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.16 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3,4-dihydro-1H-2,5,1-benzodioxazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-dihydro-1H-2,5,1-benzodioxazepine?
The IUPAC name of 3,4-dihydro-1H-2,5,1-benzodioxazepine (CID 70396307) is 3,4-dihydro-1H-2,5,1-benzodioxazepine.
What is the SMILES notation for 3,4-dihydro-1H-2,5,1-benzodioxazepine?
The canonical SMILES for 3,4-dihydro-1H-2,5,1-benzodioxazepine is c1ccc2c(c1)NOCCO2.
What is the InChIKey of 3,4-dihydro-1H-2,5,1-benzodioxazepine?
The InChIKey is VXYKQGLCIKMBSP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9NO2/c1-2-4-8-7(3-1)9-11-6-5-10-8/h1-4,9H,5-6H2.
What are the key properties of 3,4-dihydro-1H-2,5,1-benzodioxazepine?
3,4-dihydro-1H-2,5,1-benzodioxazepine has a molecular weight of 151.16 g/mol, XLogP of 1.42, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dihydro-1H-2,5,1-benzodioxazepine is sourced from PubChem (CID 70396307), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).