C30H42I2N2O8 — CID 70396415
bis(1-acetyloxy-3-iodo-2,2,6,6-tetramethylpiperidin-4-yl) benzene-1,3-dicarboxylate (PubChem CID 70396415) has the molecular formula C30H42I2N2O8 and a molecular weight of 812.48 g/mol. Its IUPAC name is bis(1-acetyloxy-3-iodo-2,2,6,6-tetramethylpiperidin-4-yl) benzene-1,3-dicarboxylate.
| Compound Name | bis(1-acetyloxy-3-iodo-2,2,6,6-tetramethylpiperidin-4-yl) benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 70396415 |
| Molecular Formula | C30H42I2N2O8 |
| Molecular Weight | 812.48 g/mol |
| Exact Mass | 812.10 |
| IUPAC Name | bis(1-acetyloxy-3-iodo-2,2,6,6-tetramethylpiperidin-4-yl) benzene-1,3-dicarboxylate |
| SMILES | CC(=O)ON1C(C)(C)CC(OC(=O)c2cccc(C(=O)OC3CC(C)(C)N(OC(C)=O)C(C)(C)C3I)c2)C(I)C1(C)C |
| InChI | InChI=1S/C30H42I2N2O8/c1-17(35)41-33-27(3,4)15-21(23(31)29(33,7)8)39-25(37)19-12-11-13-20(14-19)26(38)40-22-16-28(5,6)34(42-18(2)36)30(9,10)24(22)32/h11-14,21-24H,15-16H2,1-10H3 |
| InChIKey | CLIZEAFQPUDSNB-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 111.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 812.48 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|