C9H15NO5 — CID 70396499
acetic acid;prop-2-enoic acid;pyrrolidin-2-one (PubChem CID 70396499) has the molecular formula C9H15NO5 and a molecular weight of 217.22 g/mol. Its IUPAC name is acetic acid;prop-2-enoic acid;pyrrolidin-2-one.
| Compound Name | acetic acid;prop-2-enoic acid;pyrrolidin-2-one |
|---|---|
| PubChem CID | 70396499 |
| Molecular Formula | C9H15NO5 |
| Molecular Weight | 217.22 g/mol |
| Exact Mass | 217.10 |
| IUPAC Name | acetic acid;prop-2-enoic acid;pyrrolidin-2-one |
| SMILES | C=CC(=O)O.CC(=O)O.O=C1CCCN1 |
| InChI | InChI=1S/C4H7NO.C3H4O2.C2H4O2/c6-4-2-1-3-5-4;1-2-3(4)5;1-2(3)4/h1-3H2,(H,5,6);2H,1H2,(H,4,5);1H3,(H,3,4) |
| InChIKey | WEEMSHHLVNMUAJ-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.22 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|