C32H40N2 — CID 70396740
3,7-bis(4-ethylphenyl)-5-(4-methylphenyl)nona-3,6-diene-4,6-diamine (PubChem CID 70396740) has the molecular formula C32H40N2 and a molecular weight of 452.69 g/mol. Its IUPAC name is 3,7-bis(4-ethylphenyl)-5-(4-methylphenyl)nona-3,6-diene-4,6-diamine.
| Compound Name | 3,7-bis(4-ethylphenyl)-5-(4-methylphenyl)nona-3,6-diene-4,6-diamine |
|---|---|
| PubChem CID | 70396740 |
| Molecular Formula | C32H40N2 |
| Molecular Weight | 452.69 g/mol |
| Exact Mass | 452.32 |
| IUPAC Name | 3,7-bis(4-ethylphenyl)-5-(4-methylphenyl)nona-3,6-diene-4,6-diamine |
| SMILES | CCC(=C(N)C(C(N)=C(CC)c1ccc(CC)cc1)c1ccc(C)cc1)c1ccc(CC)cc1 |
| InChI | InChI=1S/C32H40N2/c1-6-23-12-18-25(19-13-23)28(8-3)31(33)30(27-16-10-22(5)11-17-27)32(34)29(9-4)26-20-14-24(7-2)15-21-26/h10-21,30H,6-9,33-34H2,1-5H3 |
| InChIKey | WCKRTRUNZBGQKL-UHFFFAOYSA-N |
| XLogP | 7.76 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.69 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |