C20H21N — CID 70396745
2-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),4,6,9,11,13-hexaenylidene)piperidine (PubChem CID 70396745) has the molecular formula C20H21N and a molecular weight of 275.40 g/mol. Its IUPAC name is 2-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),4,6,9,11,13-hexaenylidene)piperidine.
| Compound Name | 2-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),4,6,9,11,13-hexaenylidene)piperidine |
|---|---|
| PubChem CID | 70396745 |
| Molecular Formula | C20H21N |
| Molecular Weight | 275.40 g/mol |
| Exact Mass | 275.17 |
| IUPAC Name | 2-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),4,6,9,11,13-hexaenylidene)piperidine |
| SMILES | C1=CC2C=Cc3ccccc3C(=C3CCCCN3)C2C=C1 |
| InChI | InChI=1S/C20H21N/c1-3-9-17-15(7-1)12-13-16-8-2-4-10-18(16)20(17)19-11-5-6-14-21-19/h1-4,7-10,12-13,15,17,21H,5-6,11,14H2 |
| InChIKey | FXAPMKHPRIDFHI-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.40 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |