C29H32ClN3O6 — CID 70396962
1-[[2-[2-[(4-chlorophenyl)methyl-methylamino]ethyl]cyclopropyl]methyl]-2,6-dimethyl-4-(3-nitrophenyl)-4H-pyridine-3,5-dicarboxylic acid (PubChem CID 70396962) has the molecular formula C29H32ClN3O6 and a molecular weight of 554.04 g/mol. Its IUPAC name is 1-[[2-[2-[(4-chlorophenyl)methyl-methylamino]ethyl]cyclopropyl]methyl]-2,6-dimethyl-4-(3-nitrophenyl)-4H-pyridine-3,5-dicarboxylic acid.
| Compound Name | 1-[[2-[2-[(4-chlorophenyl)methyl-methylamino]ethyl]cyclopropyl]methyl]-2,6-dimethyl-4-(3-nitrophenyl)-4H-pyridine-3,5-dicarboxylic acid |
|---|---|
| PubChem CID | 70396962 |
| Molecular Formula | C29H32ClN3O6 |
| Molecular Weight | 554.04 g/mol |
| Exact Mass | 553.20 |
| IUPAC Name | 1-[[2-[2-[(4-chlorophenyl)methyl-methylamino]ethyl]cyclopropyl]methyl]-2,6-dimethyl-4-(3-nitrophenyl)-4H-pyridine-3,5-dicarboxylic acid |
| SMILES | CC1=C(C(=O)O)C(c2cccc([N+](=O)[O-])c2)C(C(=O)O)=C(C)N1CC1CC1CCN(C)Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C29H32ClN3O6/c1-17-25(28(34)35)27(21-5-4-6-24(14-21)33(38)39)26(29(36)37)18(2)32(17)16-22-13-20(22)11-12-31(3)15-19-7-9-23(30)10-8-19/h4-10,14,20,22,27H,11-13,15-16H2,1-3H3,(H,34,35)(H,36,37) |
| InChIKey | URZWUGDTCGGDOD-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 124.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.04 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|