About 2,4-dimethyl-1-N-(pyridin-4-ylmethyl)benzene-1,3-diamine;trihydrochloride
2,4-dimethyl-1-N-(pyridin-4-ylmethyl)benzene-1,3-diamine;trihydrochloride (PubChem CID 70397060) has the molecular formula C14H20Cl3N3
and a molecular weight of 336.69 g/mol. Its IUPAC name is 2,4-dimethyl-1-N-(pyridin-4-ylmethyl)benzene-1,3-diamine;trihydrochloride.
Molecular Properties
| Compound Name | 2,4-dimethyl-1-N-(pyridin-4-ylmethyl)benzene-1,3-diamine;trihydrochloride |
| PubChem CID | 70397060 |
| Molecular Formula | C14H20Cl3N3 |
| Molecular Weight | 336.69 g/mol |
| Exact Mass | 335.07 |
| IUPAC Name | 2,4-dimethyl-1-N-(pyridin-4-ylmethyl)benzene-1,3-diamine;trihydrochloride |
| SMILES | Cc1ccc(NCc2ccncc2)c(C)c1N.Cl.Cl.Cl |
| InChI | InChI=1S/C14H17N3.3ClH/c1-10-3-4-13(11(2)14(10)15)17-9-12-5-7-16-8-6-12;;;/h3-8,17H,9,15H2,1-2H3;3*1H |
| InChIKey | SSUOTQIPTGPBRL-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.69 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2,4-dimethyl-1-N-(pyridin-4-ylmethyl)benzene-1,3-diamine;trihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dimethyl-1-N-(pyridin-4-ylmethyl)benzene-1,3-diamine;trihydrochloride?
The IUPAC name of 2,4-dimethyl-1-N-(pyridin-4-ylmethyl)benzene-1,3-diamine;trihydrochloride (CID 70397060) is 2,4-dimethyl-1-N-(pyridin-4-ylmethyl)benzene-1,3-diamine;trihydrochloride.
What is the SMILES notation for 2,4-dimethyl-1-N-(pyridin-4-ylmethyl)benzene-1,3-diamine;trihydrochloride?
The canonical SMILES for 2,4-dimethyl-1-N-(pyridin-4-ylmethyl)benzene-1,3-diamine;trihydrochloride is Cc1ccc(NCc2ccncc2)c(C)c1N.Cl.Cl.Cl.
What is the InChIKey of 2,4-dimethyl-1-N-(pyridin-4-ylmethyl)benzene-1,3-diamine;trihydrochloride?
The InChIKey is SSUOTQIPTGPBRL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17N3.3ClH/c1-10-3-4-13(11(2)14(10)15)17-9-12-5-7-16-8-6-12;;;/h3-8,17H,9,15H2,1-2H3;3*1H.
What are the key properties of 2,4-dimethyl-1-N-(pyridin-4-ylmethyl)benzene-1,3-diamine;trihydrochloride?
2,4-dimethyl-1-N-(pyridin-4-ylmethyl)benzene-1,3-diamine;trihydrochloride has a molecular weight of 336.69 g/mol, XLogP of 4.16, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dimethyl-1-N-(pyridin-4-ylmethyl)benzene-1,3-diamine;trihydrochloride is sourced from PubChem (CID 70397060), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).