About 2-amino-4-(4-aminophenyl)benzenesulfonamide;methane
2-amino-4-(4-aminophenyl)benzenesulfonamide;methane (PubChem CID 70397114) has the molecular formula C13H17N3O2S
and a molecular weight of 279.37 g/mol. Its IUPAC name is 2-amino-4-(4-aminophenyl)benzenesulfonamide;methane.
Molecular Properties
| Compound Name | 2-amino-4-(4-aminophenyl)benzenesulfonamide;methane |
| PubChem CID | 70397114 |
| Molecular Formula | C13H17N3O2S |
| Molecular Weight | 279.37 g/mol |
| Exact Mass | 279.10 |
| IUPAC Name | 2-amino-4-(4-aminophenyl)benzenesulfonamide;methane |
| SMILES | C.Nc1ccc(-c2ccc(S(N)(=O)=O)c(N)c2)cc1 |
| InChI | InChI=1S/C12H13N3O2S.CH4/c13-10-4-1-8(2-5-10)9-3-6-12(11(14)7-9)18(15,16)17;/h1-7H,13-14H2,(H2,15,16,17);1H4 |
| InChIKey | BDWNIGRJZZJEMA-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 112.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.37 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-4-(4-aminophenyl)benzenesulfonamide;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-4-(4-aminophenyl)benzenesulfonamide;methane?
The IUPAC name of 2-amino-4-(4-aminophenyl)benzenesulfonamide;methane (CID 70397114) is 2-amino-4-(4-aminophenyl)benzenesulfonamide;methane.
What is the SMILES notation for 2-amino-4-(4-aminophenyl)benzenesulfonamide;methane?
The canonical SMILES for 2-amino-4-(4-aminophenyl)benzenesulfonamide;methane is C.Nc1ccc(-c2ccc(S(N)(=O)=O)c(N)c2)cc1.
What is the InChIKey of 2-amino-4-(4-aminophenyl)benzenesulfonamide;methane?
The InChIKey is BDWNIGRJZZJEMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13N3O2S.CH4/c13-10-4-1-8(2-5-10)9-3-6-12(11(14)7-9)18(15,16)17;/h1-7H,13-14H2,(H2,15,16,17);1H4.
What are the key properties of 2-amino-4-(4-aminophenyl)benzenesulfonamide;methane?
2-amino-4-(4-aminophenyl)benzenesulfonamide;methane has a molecular weight of 279.37 g/mol, XLogP of 1.80, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-4-(4-aminophenyl)benzenesulfonamide;methane is sourced from PubChem (CID 70397114), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).