About 2-(5H-benzimidazol-2-ylsulfinylmethyl)-N,N,4-trimethylaniline
2-(5H-benzimidazol-2-ylsulfinylmethyl)-N,N,4-trimethylaniline (PubChem CID 70397296) has the molecular formula C17H19N3OS
and a molecular weight of 313.43 g/mol. Its IUPAC name is 2-(5H-benzimidazol-2-ylsulfinylmethyl)-N,N,4-trimethylaniline.
Molecular Properties
| Compound Name | 2-(5H-benzimidazol-2-ylsulfinylmethyl)-N,N,4-trimethylaniline |
| PubChem CID | 70397296 |
| Molecular Formula | C17H19N3OS |
| Molecular Weight | 313.43 g/mol |
| Exact Mass | 313.12 |
| IUPAC Name | 2-(5H-benzimidazol-2-ylsulfinylmethyl)-N,N,4-trimethylaniline |
| SMILES | Cc1ccc(N(C)C)c(CS(=O)C2=NC3=CCC=CC3=N2)c1 |
| InChI | InChI=1S/C17H19N3OS/c1-12-8-9-16(20(2)3)13(10-12)11-22(21)17-18-14-6-4-5-7-15(14)19-17/h4,6-10H,5,11H2,1-3H3 |
| InChIKey | GWKHYPMWYQHUSO-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 45.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.43 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(5H-benzimidazol-2-ylsulfinylmethyl)-N,N,4-trimethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5H-benzimidazol-2-ylsulfinylmethyl)-N,N,4-trimethylaniline?
The IUPAC name of 2-(5H-benzimidazol-2-ylsulfinylmethyl)-N,N,4-trimethylaniline (CID 70397296) is 2-(5H-benzimidazol-2-ylsulfinylmethyl)-N,N,4-trimethylaniline.
What is the SMILES notation for 2-(5H-benzimidazol-2-ylsulfinylmethyl)-N,N,4-trimethylaniline?
The canonical SMILES for 2-(5H-benzimidazol-2-ylsulfinylmethyl)-N,N,4-trimethylaniline is Cc1ccc(N(C)C)c(CS(=O)C2=NC3=CCC=CC3=N2)c1.
What is the InChIKey of 2-(5H-benzimidazol-2-ylsulfinylmethyl)-N,N,4-trimethylaniline?
The InChIKey is GWKHYPMWYQHUSO-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19N3OS/c1-12-8-9-16(20(2)3)13(10-12)11-22(21)17-18-14-6-4-5-7-15(14)19-17/h4,6-10H,5,11H2,1-3H3.
What are the key properties of 2-(5H-benzimidazol-2-ylsulfinylmethyl)-N,N,4-trimethylaniline?
2-(5H-benzimidazol-2-ylsulfinylmethyl)-N,N,4-trimethylaniline has a molecular weight of 313.43 g/mol, XLogP of 2.96, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5H-benzimidazol-2-ylsulfinylmethyl)-N,N,4-trimethylaniline is sourced from PubChem (CID 70397296), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).