About 6-(diethylaminomethyl)-3,6-dimethylcyclohexa-2,4-dien-1-ol
6-(diethylaminomethyl)-3,6-dimethylcyclohexa-2,4-dien-1-ol (PubChem CID 70397430) has the molecular formula C13H23NO
and a molecular weight of 209.33 g/mol. Its IUPAC name is 6-(diethylaminomethyl)-3,6-dimethylcyclohexa-2,4-dien-1-ol.
Molecular Properties
| Compound Name | 6-(diethylaminomethyl)-3,6-dimethylcyclohexa-2,4-dien-1-ol |
| PubChem CID | 70397430 |
| Molecular Formula | C13H23NO |
| Molecular Weight | 209.33 g/mol |
| Exact Mass | 209.18 |
| IUPAC Name | 6-(diethylaminomethyl)-3,6-dimethylcyclohexa-2,4-dien-1-ol |
| SMILES | CCN(CC)CC1(C)C=CC(C)=CC1O |
| InChI | InChI=1S/C13H23NO/c1-5-14(6-2)10-13(4)8-7-11(3)9-12(13)15/h7-9,12,15H,5-6,10H2,1-4H3 |
| InChIKey | VJTSLCVDTMYLFB-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.33 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-(diethylaminomethyl)-3,6-dimethylcyclohexa-2,4-dien-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(diethylaminomethyl)-3,6-dimethylcyclohexa-2,4-dien-1-ol?
The IUPAC name of 6-(diethylaminomethyl)-3,6-dimethylcyclohexa-2,4-dien-1-ol (CID 70397430) is 6-(diethylaminomethyl)-3,6-dimethylcyclohexa-2,4-dien-1-ol.
What is the SMILES notation for 6-(diethylaminomethyl)-3,6-dimethylcyclohexa-2,4-dien-1-ol?
The canonical SMILES for 6-(diethylaminomethyl)-3,6-dimethylcyclohexa-2,4-dien-1-ol is CCN(CC)CC1(C)C=CC(C)=CC1O.
What is the InChIKey of 6-(diethylaminomethyl)-3,6-dimethylcyclohexa-2,4-dien-1-ol?
The InChIKey is VJTSLCVDTMYLFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H23NO/c1-5-14(6-2)10-13(4)8-7-11(3)9-12(13)15/h7-9,12,15H,5-6,10H2,1-4H3.
What are the key properties of 6-(diethylaminomethyl)-3,6-dimethylcyclohexa-2,4-dien-1-ol?
6-(diethylaminomethyl)-3,6-dimethylcyclohexa-2,4-dien-1-ol has a molecular weight of 209.33 g/mol, XLogP of 2.21, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(diethylaminomethyl)-3,6-dimethylcyclohexa-2,4-dien-1-ol is sourced from PubChem (CID 70397430), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).