About 4-ethyl-1,2-benzothiazol-3-one
4-ethyl-1,2-benzothiazol-3-one (PubChem CID 70397576) has the molecular formula C9H9NOS
and a molecular weight of 179.24 g/mol. Its IUPAC name is 4-ethyl-1,2-benzothiazol-3-one.
Molecular Properties
| Compound Name | 4-ethyl-1,2-benzothiazol-3-one |
| PubChem CID | 70397576 |
| Molecular Formula | C9H9NOS |
| Molecular Weight | 179.24 g/mol |
| Exact Mass | 179.04 |
| IUPAC Name | 4-ethyl-1,2-benzothiazol-3-one |
| SMILES | CCc1cccc2s[nH]c(=O)c12 |
| InChI | InChI=1S/C9H9NOS/c1-2-6-4-3-5-7-8(6)9(11)10-12-7/h3-5H,2H2,1H3,(H,10,11) |
| InChIKey | GDQFEIUQYLJJGI-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.24 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-ethyl-1,2-benzothiazol-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethyl-1,2-benzothiazol-3-one?
The IUPAC name of 4-ethyl-1,2-benzothiazol-3-one (CID 70397576) is 4-ethyl-1,2-benzothiazol-3-one.
What is the SMILES notation for 4-ethyl-1,2-benzothiazol-3-one?
The canonical SMILES for 4-ethyl-1,2-benzothiazol-3-one is CCc1cccc2s[nH]c(=O)c12.
What is the InChIKey of 4-ethyl-1,2-benzothiazol-3-one?
The InChIKey is GDQFEIUQYLJJGI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9NOS/c1-2-6-4-3-5-7-8(6)9(11)10-12-7/h3-5H,2H2,1H3,(H,10,11).
What are the key properties of 4-ethyl-1,2-benzothiazol-3-one?
4-ethyl-1,2-benzothiazol-3-one has a molecular weight of 179.24 g/mol, XLogP of 2.15, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethyl-1,2-benzothiazol-3-one is sourced from PubChem (CID 70397576), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).