About 2-benzyl-3,4-dimethylbenzenesulfonamide
2-benzyl-3,4-dimethylbenzenesulfonamide (PubChem CID 70397588) has the molecular formula C15H17NO2S
and a molecular weight of 275.37 g/mol. Its IUPAC name is 2-benzyl-3,4-dimethylbenzenesulfonamide.
Molecular Properties
| Compound Name | 2-benzyl-3,4-dimethylbenzenesulfonamide |
| PubChem CID | 70397588 |
| Molecular Formula | C15H17NO2S |
| Molecular Weight | 275.37 g/mol |
| Exact Mass | 275.10 |
| IUPAC Name | 2-benzyl-3,4-dimethylbenzenesulfonamide |
| SMILES | Cc1ccc(S(N)(=O)=O)c(Cc2ccccc2)c1C |
| InChI | InChI=1S/C15H17NO2S/c1-11-8-9-15(19(16,17)18)14(12(11)2)10-13-6-4-3-5-7-13/h3-9H,10H2,1-2H3,(H2,16,17,18) |
| InChIKey | LCAPNWUQEZFZMJ-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.37 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-benzyl-3,4-dimethylbenzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-benzyl-3,4-dimethylbenzenesulfonamide?
The IUPAC name of 2-benzyl-3,4-dimethylbenzenesulfonamide (CID 70397588) is 2-benzyl-3,4-dimethylbenzenesulfonamide.
What is the SMILES notation for 2-benzyl-3,4-dimethylbenzenesulfonamide?
The canonical SMILES for 2-benzyl-3,4-dimethylbenzenesulfonamide is Cc1ccc(S(N)(=O)=O)c(Cc2ccccc2)c1C.
What is the InChIKey of 2-benzyl-3,4-dimethylbenzenesulfonamide?
The InChIKey is LCAPNWUQEZFZMJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17NO2S/c1-11-8-9-15(19(16,17)18)14(12(11)2)10-13-6-4-3-5-7-13/h3-9H,10H2,1-2H3,(H2,16,17,18).
What are the key properties of 2-benzyl-3,4-dimethylbenzenesulfonamide?
2-benzyl-3,4-dimethylbenzenesulfonamide has a molecular weight of 275.37 g/mol, XLogP of 2.54, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzyl-3,4-dimethylbenzenesulfonamide is sourced from PubChem (CID 70397588), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).