About 4-methylidene-2-pentyl-2,5-dihydro-1H-indol-3-one
4-methylidene-2-pentyl-2,5-dihydro-1H-indol-3-one (PubChem CID 70398046) has the molecular formula C14H19NO
and a molecular weight of 217.31 g/mol. Its IUPAC name is 4-methylidene-2-pentyl-2,5-dihydro-1H-indol-3-one.
Molecular Properties
| Compound Name | 4-methylidene-2-pentyl-2,5-dihydro-1H-indol-3-one |
| PubChem CID | 70398046 |
| Molecular Formula | C14H19NO |
| Molecular Weight | 217.31 g/mol |
| Exact Mass | 217.15 |
| IUPAC Name | 4-methylidene-2-pentyl-2,5-dihydro-1H-indol-3-one |
| SMILES | C=C1CC=CC2=C1C(=O)C(CCCCC)N2 |
| InChI | InChI=1S/C14H19NO/c1-3-4-5-8-12-14(16)13-10(2)7-6-9-11(13)15-12/h6,9,12,15H,2-5,7-8H2,1H3 |
| InChIKey | CFVANWYUSPAGMJ-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.31 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-methylidene-2-pentyl-2,5-dihydro-1H-indol-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylidene-2-pentyl-2,5-dihydro-1H-indol-3-one?
The IUPAC name of 4-methylidene-2-pentyl-2,5-dihydro-1H-indol-3-one (CID 70398046) is 4-methylidene-2-pentyl-2,5-dihydro-1H-indol-3-one.
What is the SMILES notation for 4-methylidene-2-pentyl-2,5-dihydro-1H-indol-3-one?
The canonical SMILES for 4-methylidene-2-pentyl-2,5-dihydro-1H-indol-3-one is C=C1CC=CC2=C1C(=O)C(CCCCC)N2.
What is the InChIKey of 4-methylidene-2-pentyl-2,5-dihydro-1H-indol-3-one?
The InChIKey is CFVANWYUSPAGMJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19NO/c1-3-4-5-8-12-14(16)13-10(2)7-6-9-11(13)15-12/h6,9,12,15H,2-5,7-8H2,1H3.
What are the key properties of 4-methylidene-2-pentyl-2,5-dihydro-1H-indol-3-one?
4-methylidene-2-pentyl-2,5-dihydro-1H-indol-3-one has a molecular weight of 217.31 g/mol, XLogP of 2.88, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylidene-2-pentyl-2,5-dihydro-1H-indol-3-one is sourced from PubChem (CID 70398046), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).