About 2-amino-2-(4-chlorophenyl)-3,5-dihydro-1,5-benzothiazepin-4-one;hydrobromide
2-amino-2-(4-chlorophenyl)-3,5-dihydro-1,5-benzothiazepin-4-one;hydrobromide (PubChem CID 70398091) has the molecular formula C15H14BrClN2OS
and a molecular weight of 385.71 g/mol. Its IUPAC name is 2-amino-2-(4-chlorophenyl)-3,5-dihydro-1,5-benzothiazepin-4-one;hydrobromide.
Molecular Properties
| Compound Name | 2-amino-2-(4-chlorophenyl)-3,5-dihydro-1,5-benzothiazepin-4-one;hydrobromide |
| PubChem CID | 70398091 |
| Molecular Formula | C15H14BrClN2OS |
| Molecular Weight | 385.71 g/mol |
| Exact Mass | 383.97 |
| IUPAC Name | 2-amino-2-(4-chlorophenyl)-3,5-dihydro-1,5-benzothiazepin-4-one;hydrobromide |
| SMILES | Br.NC1(c2ccc(Cl)cc2)CC(=O)Nc2ccccc2S1 |
| InChI | InChI=1S/C15H13ClN2OS.BrH/c16-11-7-5-10(6-8-11)15(17)9-14(19)18-12-3-1-2-4-13(12)20-15;/h1-8H,9,17H2,(H,18,19);1H |
| InChIKey | BNPMOSGHHDPCGH-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 385.71 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-amino-2-(4-chlorophenyl)-3,5-dihydro-1,5-benzothiazepin-4-one;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-2-(4-chlorophenyl)-3,5-dihydro-1,5-benzothiazepin-4-one;hydrobromide?
The IUPAC name of 2-amino-2-(4-chlorophenyl)-3,5-dihydro-1,5-benzothiazepin-4-one;hydrobromide (CID 70398091) is 2-amino-2-(4-chlorophenyl)-3,5-dihydro-1,5-benzothiazepin-4-one;hydrobromide.
What is the SMILES notation for 2-amino-2-(4-chlorophenyl)-3,5-dihydro-1,5-benzothiazepin-4-one;hydrobromide?
The canonical SMILES for 2-amino-2-(4-chlorophenyl)-3,5-dihydro-1,5-benzothiazepin-4-one;hydrobromide is Br.NC1(c2ccc(Cl)cc2)CC(=O)Nc2ccccc2S1.
What is the InChIKey of 2-amino-2-(4-chlorophenyl)-3,5-dihydro-1,5-benzothiazepin-4-one;hydrobromide?
The InChIKey is BNPMOSGHHDPCGH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13ClN2OS.BrH/c16-11-7-5-10(6-8-11)15(17)9-14(19)18-12-3-1-2-4-13(12)20-15;/h1-8H,9,17H2,(H,18,19);1H.
What are the key properties of 2-amino-2-(4-chlorophenyl)-3,5-dihydro-1,5-benzothiazepin-4-one;hydrobromide?
2-amino-2-(4-chlorophenyl)-3,5-dihydro-1,5-benzothiazepin-4-one;hydrobromide has a molecular weight of 385.71 g/mol, XLogP of 4.16, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-2-(4-chlorophenyl)-3,5-dihydro-1,5-benzothiazepin-4-one;hydrobromide is sourced from PubChem (CID 70398091), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).