About 2,6-dimethyl-2-piperazin-1-yl-1H-pyrimidine;dihydrochloride
2,6-dimethyl-2-piperazin-1-yl-1H-pyrimidine;dihydrochloride (PubChem CID 70398201) has the molecular formula C10H20Cl2N4
and a molecular weight of 267.20 g/mol. Its IUPAC name is 2,6-dimethyl-2-piperazin-1-yl-1H-pyrimidine;dihydrochloride.
Molecular Properties
| Compound Name | 2,6-dimethyl-2-piperazin-1-yl-1H-pyrimidine;dihydrochloride |
| PubChem CID | 70398201 |
| Molecular Formula | C10H20Cl2N4 |
| Molecular Weight | 267.20 g/mol |
| Exact Mass | 266.11 |
| IUPAC Name | 2,6-dimethyl-2-piperazin-1-yl-1H-pyrimidine;dihydrochloride |
| SMILES | CC1=CC=NC(C)(N2CCNCC2)N1.Cl.Cl |
| InChI | InChI=1S/C10H18N4.2ClH/c1-9-3-4-12-10(2,13-9)14-7-5-11-6-8-14;;/h3-4,11,13H,5-8H2,1-2H3;2*1H |
| InChIKey | IROYCCTWSMZMSI-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.20 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2,6-dimethyl-2-piperazin-1-yl-1H-pyrimidine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-dimethyl-2-piperazin-1-yl-1H-pyrimidine;dihydrochloride?
The IUPAC name of 2,6-dimethyl-2-piperazin-1-yl-1H-pyrimidine;dihydrochloride (CID 70398201) is 2,6-dimethyl-2-piperazin-1-yl-1H-pyrimidine;dihydrochloride.
What is the SMILES notation for 2,6-dimethyl-2-piperazin-1-yl-1H-pyrimidine;dihydrochloride?
The canonical SMILES for 2,6-dimethyl-2-piperazin-1-yl-1H-pyrimidine;dihydrochloride is CC1=CC=NC(C)(N2CCNCC2)N1.Cl.Cl.
What is the InChIKey of 2,6-dimethyl-2-piperazin-1-yl-1H-pyrimidine;dihydrochloride?
The InChIKey is IROYCCTWSMZMSI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18N4.2ClH/c1-9-3-4-12-10(2,13-9)14-7-5-11-6-8-14;;/h3-4,11,13H,5-8H2,1-2H3;2*1H.
What are the key properties of 2,6-dimethyl-2-piperazin-1-yl-1H-pyrimidine;dihydrochloride?
2,6-dimethyl-2-piperazin-1-yl-1H-pyrimidine;dihydrochloride has a molecular weight of 267.20 g/mol, XLogP of 0.99, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-dimethyl-2-piperazin-1-yl-1H-pyrimidine;dihydrochloride is sourced from PubChem (CID 70398201), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).