About 3aH-pyrrolo[3,4-b]quinoline-3,5-dione
3aH-pyrrolo[3,4-b]quinoline-3,5-dione (PubChem CID 70398225) has the molecular formula C11H6N2O2
and a molecular weight of 198.18 g/mol. Its IUPAC name is 3aH-pyrrolo[3,4-b]quinoline-3,5-dione.
Molecular Properties
| Compound Name | 3aH-pyrrolo[3,4-b]quinoline-3,5-dione |
| PubChem CID | 70398225 |
| Molecular Formula | C11H6N2O2 |
| Molecular Weight | 198.18 g/mol |
| Exact Mass | 198.04 |
| IUPAC Name | 3aH-pyrrolo[3,4-b]quinoline-3,5-dione |
| SMILES | O=C1C=CC=C2C=C3C=NC(=O)C3N=C12 |
| InChI | InChI=1S/C11H6N2O2/c14-8-3-1-2-6-4-7-5-12-11(15)10(7)13-9(6)8/h1-5,10H |
| InChIKey | QJGNYPZJTIGDBF-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 58.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.18 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'} |
|---|
Analyze 3aH-pyrrolo[3,4-b]quinoline-3,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3aH-pyrrolo[3,4-b]quinoline-3,5-dione?
The IUPAC name of 3aH-pyrrolo[3,4-b]quinoline-3,5-dione (CID 70398225) is 3aH-pyrrolo[3,4-b]quinoline-3,5-dione.
What is the SMILES notation for 3aH-pyrrolo[3,4-b]quinoline-3,5-dione?
The canonical SMILES for 3aH-pyrrolo[3,4-b]quinoline-3,5-dione is O=C1C=CC=C2C=C3C=NC(=O)C3N=C12.
What is the InChIKey of 3aH-pyrrolo[3,4-b]quinoline-3,5-dione?
The InChIKey is QJGNYPZJTIGDBF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H6N2O2/c14-8-3-1-2-6-4-7-5-12-11(15)10(7)13-9(6)8/h1-5,10H.
What are the key properties of 3aH-pyrrolo[3,4-b]quinoline-3,5-dione?
3aH-pyrrolo[3,4-b]quinoline-3,5-dione has a molecular weight of 198.18 g/mol, XLogP of 0.41, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3aH-pyrrolo[3,4-b]quinoline-3,5-dione is sourced from PubChem (CID 70398225), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).