C48H42N4 — CID 70398304
2,4,6,8-tetramethyl-1,3,5,7-tetraphenyl-21,23-dihydro-5H-porphyrin (PubChem CID 70398304) has the molecular formula C48H42N4 and a molecular weight of 674.89 g/mol. Its IUPAC name is 2,4,6,8-tetramethyl-1,3,5,7-tetraphenyl-21,23-dihydro-5H-porphyrin.
| Compound Name | 2,4,6,8-tetramethyl-1,3,5,7-tetraphenyl-21,23-dihydro-5H-porphyrin |
|---|---|
| PubChem CID | 70398304 |
| Molecular Formula | C48H42N4 |
| Molecular Weight | 674.89 g/mol |
| Exact Mass | 674.34 |
| IUPAC Name | 2,4,6,8-tetramethyl-1,3,5,7-tetraphenyl-21,23-dihydro-5H-porphyrin |
| SMILES | CC1=C(c2ccccc2)C2(C)N=C1C=c1ccc([nH]1)=CC1=NC(=CC3(c4ccccc4)NC(C)(C(c4ccccc4)=C3C)C2c2ccccc2)C=C1 |
| InChI | InChI=1S/C48H42N4/c1-32-42-30-40-26-25-38(49-40)29-39-27-28-41(50-39)31-48(37-23-15-8-16-24-37)33(2)44(35-19-11-6-12-20-35)47(4,52-48)45(36-21-13-7-14-22-36)46(3,51-42)43(32)34-17-9-5-10-18-34/h5-31,45,49,52H,1-4H3 |
| InChIKey | MTFLFRCZTWMJED-UHFFFAOYSA-N |
| XLogP | 8.69 |
| TPSA | 52.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.89 |
| LogP ≤ 5 | 8.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |