About 6,11-dihydro-5H-pyrido[4,3-c][1]benzazepin-11-ol
6,11-dihydro-5H-pyrido[4,3-c][1]benzazepin-11-ol (PubChem CID 70399337) has the molecular formula C13H12N2O
and a molecular weight of 212.25 g/mol. Its IUPAC name is 6,11-dihydro-5H-pyrido[4,3-c][1]benzazepin-11-ol.
Molecular Properties
| Compound Name | 6,11-dihydro-5H-pyrido[4,3-c][1]benzazepin-11-ol |
| PubChem CID | 70399337 |
| Molecular Formula | C13H12N2O |
| Molecular Weight | 212.25 g/mol |
| Exact Mass | 212.09 |
| IUPAC Name | 6,11-dihydro-5H-pyrido[4,3-c][1]benzazepin-11-ol |
| SMILES | OC1c2cnccc2CNc2ccccc21 |
| InChI | InChI=1S/C13H12N2O/c16-13-10-3-1-2-4-12(10)15-7-9-5-6-14-8-11(9)13/h1-6,8,13,15-16H,7H2 |
| InChIKey | BGYRROLVBPYVIJ-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.25 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6,11-dihydro-5H-pyrido[4,3-c][1]benzazepin-11-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,11-dihydro-5H-pyrido[4,3-c][1]benzazepin-11-ol?
The IUPAC name of 6,11-dihydro-5H-pyrido[4,3-c][1]benzazepin-11-ol (CID 70399337) is 6,11-dihydro-5H-pyrido[4,3-c][1]benzazepin-11-ol.
What is the SMILES notation for 6,11-dihydro-5H-pyrido[4,3-c][1]benzazepin-11-ol?
The canonical SMILES for 6,11-dihydro-5H-pyrido[4,3-c][1]benzazepin-11-ol is OC1c2cnccc2CNc2ccccc21.
What is the InChIKey of 6,11-dihydro-5H-pyrido[4,3-c][1]benzazepin-11-ol?
The InChIKey is BGYRROLVBPYVIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12N2O/c16-13-10-3-1-2-4-12(10)15-7-9-5-6-14-8-11(9)13/h1-6,8,13,15-16H,7H2.
What are the key properties of 6,11-dihydro-5H-pyrido[4,3-c][1]benzazepin-11-ol?
6,11-dihydro-5H-pyrido[4,3-c][1]benzazepin-11-ol has a molecular weight of 212.25 g/mol, XLogP of 2.09, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6,11-dihydro-5H-pyrido[4,3-c][1]benzazepin-11-ol is sourced from PubChem (CID 70399337), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).