C24H43NO7 — CID 70399399
tert-butyl (4S,5R)-4-(cyclohexylmethyl)-5-[(1R,2R)-1,5-dihydroxy-2-methoxycarbonylpentyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate (PubChem CID 70399399) has the molecular formula C24H43NO7 and a molecular weight of 457.61 g/mol. Its IUPAC name is tert-butyl (4S,5R)-4-(cyclohexylmethyl)-5-[(1R,2R)-1,5-dihydroxy-2-methoxycarbonylpentyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate.
| Compound Name | tert-butyl (4S,5R)-4-(cyclohexylmethyl)-5-[(1R,2R)-1,5-dihydroxy-2-methoxycarbonylpentyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 70399399 |
| Molecular Formula | C24H43NO7 |
| Molecular Weight | 457.61 g/mol |
| Exact Mass | 457.30 |
| IUPAC Name | tert-butyl (4S,5R)-4-(cyclohexylmethyl)-5-[(1R,2R)-1,5-dihydroxy-2-methoxycarbonylpentyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
| SMILES | COC(=O)[C@H](CCCO)[C@@H](O)[C@@H]1OC(C)(C)N(C(=O)OC(C)(C)C)[C@H]1CC1CCCCC1 |
| InChI | InChI=1S/C24H43NO7/c1-23(2,3)32-22(29)25-18(15-16-11-8-7-9-12-16)20(31-24(25,4)5)19(27)17(13-10-14-26)21(28)30-6/h16-20,26-27H,7-15H2,1-6H3/t17-,18+,19-,20-/m1/s1 |
| InChIKey | SUYGYYGVEWZDTP-IYWMVGAKSA-N |
| XLogP | 3.62 |
| TPSA | 105.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.61 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |