About 5-ethoxy-5,6-difluorocyclohexa-1,3-diene
5-ethoxy-5,6-difluorocyclohexa-1,3-diene (PubChem CID 70399735) has the molecular formula C8H10F2O
and a molecular weight of 160.16 g/mol. Its IUPAC name is 5-ethoxy-5,6-difluorocyclohexa-1,3-diene.
Molecular Properties
| Compound Name | 5-ethoxy-5,6-difluorocyclohexa-1,3-diene |
| PubChem CID | 70399735 |
| Molecular Formula | C8H10F2O |
| Molecular Weight | 160.16 g/mol |
| Exact Mass | 160.07 |
| IUPAC Name | 5-ethoxy-5,6-difluorocyclohexa-1,3-diene |
| SMILES | CCOC1(F)C=CC=CC1F |
| InChI | InChI=1S/C8H10F2O/c1-2-11-8(10)6-4-3-5-7(8)9/h3-7H,2H2,1H3 |
| InChIKey | MLCUVOUTKHOMHY-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.16 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-ethoxy-5,6-difluorocyclohexa-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethoxy-5,6-difluorocyclohexa-1,3-diene?
The IUPAC name of 5-ethoxy-5,6-difluorocyclohexa-1,3-diene (CID 70399735) is 5-ethoxy-5,6-difluorocyclohexa-1,3-diene.
What is the SMILES notation for 5-ethoxy-5,6-difluorocyclohexa-1,3-diene?
The canonical SMILES for 5-ethoxy-5,6-difluorocyclohexa-1,3-diene is CCOC1(F)C=CC=CC1F.
What is the InChIKey of 5-ethoxy-5,6-difluorocyclohexa-1,3-diene?
The InChIKey is MLCUVOUTKHOMHY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10F2O/c1-2-11-8(10)6-4-3-5-7(8)9/h3-7H,2H2,1H3.
What are the key properties of 5-ethoxy-5,6-difluorocyclohexa-1,3-diene?
5-ethoxy-5,6-difluorocyclohexa-1,3-diene has a molecular weight of 160.16 g/mol, XLogP of 2.15, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethoxy-5,6-difluorocyclohexa-1,3-diene is sourced from PubChem (CID 70399735), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).