C18H27NO4 — CID 70399819
1-(2,2,6,6-tetramethyl-3-oxo-4-prop-2-enoylpiperidin-1-yl)propan-2-yl prop-2-enoate (PubChem CID 70399819) has the molecular formula C18H27NO4 and a molecular weight of 321.42 g/mol. Its IUPAC name is 1-(2,2,6,6-tetramethyl-3-oxo-4-prop-2-enoylpiperidin-1-yl)propan-2-yl prop-2-enoate.
| Compound Name | 1-(2,2,6,6-tetramethyl-3-oxo-4-prop-2-enoylpiperidin-1-yl)propan-2-yl prop-2-enoate |
|---|---|
| PubChem CID | 70399819 |
| Molecular Formula | C18H27NO4 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.19 |
| IUPAC Name | 1-(2,2,6,6-tetramethyl-3-oxo-4-prop-2-enoylpiperidin-1-yl)propan-2-yl prop-2-enoate |
| SMILES | C=CC(=O)OC(C)CN1C(C)(C)CC(C(=O)C=C)C(=O)C1(C)C |
| InChI | InChI=1S/C18H27NO4/c1-8-14(20)13-10-17(4,5)19(18(6,7)16(13)22)11-12(3)23-15(21)9-2/h8-9,12-13H,1-2,10-11H2,3-7H3 |
| InChIKey | MOPNEPRPDSQDLP-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|