C12H8Cl4N2O5S2 — CID 70400082
3,4-dichloro-2-(2,3-dichloro-6-sulfamoylphenoxy)benzenesulfonamide (PubChem CID 70400082) has the molecular formula C12H8Cl4N2O5S2 and a molecular weight of 466.15 g/mol. Its IUPAC name is 3,4-dichloro-2-(2,3-dichloro-6-sulfamoylphenoxy)benzenesulfonamide.
| Compound Name | 3,4-dichloro-2-(2,3-dichloro-6-sulfamoylphenoxy)benzenesulfonamide |
|---|---|
| PubChem CID | 70400082 |
| Molecular Formula | C12H8Cl4N2O5S2 |
| Molecular Weight | 466.15 g/mol |
| Exact Mass | 463.86 |
| IUPAC Name | 3,4-dichloro-2-(2,3-dichloro-6-sulfamoylphenoxy)benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(Cl)c(Cl)c1Oc1c(S(N)(=O)=O)ccc(Cl)c1Cl |
| InChI | InChI=1S/C12H8Cl4N2O5S2/c13-5-1-3-7(24(17,19)20)11(9(5)15)23-12-8(25(18,21)22)4-2-6(14)10(12)16/h1-4H,(H2,17,19,20)(H2,18,21,22) |
| InChIKey | HLEMCXMWHSWSFI-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 129.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.15 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |