C21H37F3O2Si — CID 70400120
(1R,3aR,7aR)-7a-methyl-1-[(6R)-7,7,7-trifluoro-6-methyl-6-trimethylsilyloxyheptan-2-yl]-2,3,3a,5,6,7-hexahydro-1H-inden-4-one (PubChem CID 70400120) has the molecular formula C21H37F3O2Si and a molecular weight of 406.61 g/mol. Its IUPAC name is (1R,3aR,7aR)-7a-methyl-1-[(6R)-7,7,7-trifluoro-6-methyl-6-trimethylsilyloxyheptan-2-yl]-2,3,3a,5,6,7-hexahydro-1H-inden-4-one.
| Compound Name | (1R,3aR,7aR)-7a-methyl-1-[(6R)-7,7,7-trifluoro-6-methyl-6-trimethylsilyloxyheptan-2-yl]-2,3,3a,5,6,7-hexahydro-1H-inden-4-one |
|---|---|
| PubChem CID | 70400120 |
| Molecular Formula | C21H37F3O2Si |
| Molecular Weight | 406.61 g/mol |
| Exact Mass | 406.25 |
| IUPAC Name | (1R,3aR,7aR)-7a-methyl-1-[(6R)-7,7,7-trifluoro-6-methyl-6-trimethylsilyloxyheptan-2-yl]-2,3,3a,5,6,7-hexahydro-1H-inden-4-one |
| SMILES | CC(CCC[C@@](C)(O[Si](C)(C)C)C(F)(F)F)[C@H]1CC[C@H]2C(=O)CCC[C@]12C |
| InChI | InChI=1S/C21H37F3O2Si/c1-15(16-11-12-17-18(25)10-8-13-19(16,17)2)9-7-14-20(3,21(22,23)24)26-27(4,5)6/h15-17H,7-14H2,1-6H3/t15?,16-,17+,19-,20-/m1/s1 |
| InChIKey | XBLMKDPAFOSBLC-RXWAUAPXSA-N |
| XLogP | 6.75 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.61 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|