About 4-[(3,4-dichlorophenyl)methylidene]-1,3-oxazol-5-one
4-[(3,4-dichlorophenyl)methylidene]-1,3-oxazol-5-one (PubChem CID 70400819) has the molecular formula C10H5Cl2NO2
and a molecular weight of 242.06 g/mol. Its IUPAC name is 4-[(3,4-dichlorophenyl)methylidene]-1,3-oxazol-5-one.
Molecular Properties
| Compound Name | 4-[(3,4-dichlorophenyl)methylidene]-1,3-oxazol-5-one |
| PubChem CID | 70400819 |
| Molecular Formula | C10H5Cl2NO2 |
| Molecular Weight | 242.06 g/mol |
| Exact Mass | 240.97 |
| IUPAC Name | 4-[(3,4-dichlorophenyl)methylidene]-1,3-oxazol-5-one |
| SMILES | O=C1OC=NC1=Cc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C10H5Cl2NO2/c11-7-2-1-6(3-8(7)12)4-9-10(14)15-5-13-9/h1-5H |
| InChIKey | AXOKGWFFDACJBZ-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.06 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 4-[(3,4-dichlorophenyl)methylidene]-1,3-oxazol-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(3,4-dichlorophenyl)methylidene]-1,3-oxazol-5-one?
The IUPAC name of 4-[(3,4-dichlorophenyl)methylidene]-1,3-oxazol-5-one (CID 70400819) is 4-[(3,4-dichlorophenyl)methylidene]-1,3-oxazol-5-one.
What is the SMILES notation for 4-[(3,4-dichlorophenyl)methylidene]-1,3-oxazol-5-one?
The canonical SMILES for 4-[(3,4-dichlorophenyl)methylidene]-1,3-oxazol-5-one is O=C1OC=NC1=Cc1ccc(Cl)c(Cl)c1.
What is the InChIKey of 4-[(3,4-dichlorophenyl)methylidene]-1,3-oxazol-5-one?
The InChIKey is AXOKGWFFDACJBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H5Cl2NO2/c11-7-2-1-6(3-8(7)12)4-9-10(14)15-5-13-9/h1-5H.
What are the key properties of 4-[(3,4-dichlorophenyl)methylidene]-1,3-oxazol-5-one?
4-[(3,4-dichlorophenyl)methylidene]-1,3-oxazol-5-one has a molecular weight of 242.06 g/mol, XLogP of 2.92, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(3,4-dichlorophenyl)methylidene]-1,3-oxazol-5-one is sourced from PubChem (CID 70400819), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).