C22H44OSi — CID 70400848
8-(2,3,4,5,6,6a-hexahydro-1H-pentalen-3a-yl)octoxy-butyl-dimethylsilane (PubChem CID 70400848) has the molecular formula C22H44OSi and a molecular weight of 352.68 g/mol. Its IUPAC name is 8-(2,3,4,5,6,6a-hexahydro-1H-pentalen-3a-yl)octoxy-butyl-dimethylsilane.
| Compound Name | 8-(2,3,4,5,6,6a-hexahydro-1H-pentalen-3a-yl)octoxy-butyl-dimethylsilane |
|---|---|
| PubChem CID | 70400848 |
| Molecular Formula | C22H44OSi |
| Molecular Weight | 352.68 g/mol |
| Exact Mass | 352.32 |
| IUPAC Name | 8-(2,3,4,5,6,6a-hexahydro-1H-pentalen-3a-yl)octoxy-butyl-dimethylsilane |
| SMILES | CCCC[Si](C)(C)OCCCCCCCCC12CCCC1CCC2 |
| InChI | InChI=1S/C22H44OSi/c1-4-5-20-24(2,3)23-19-11-9-7-6-8-10-16-22-17-12-14-21(22)15-13-18-22/h21H,4-20H2,1-3H3 |
| InChIKey | DHZDNABJAHQTFO-UHFFFAOYSA-N |
| XLogP | 7.71 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.68 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|