About 2-cyclohexyl-7H-purine
2-cyclohexyl-7H-purine (PubChem CID 70401170) has the molecular formula C11H14N4
and a molecular weight of 202.26 g/mol. Its IUPAC name is 2-cyclohexyl-7H-purine.
Molecular Properties
| Compound Name | 2-cyclohexyl-7H-purine |
| PubChem CID | 70401170 |
| Molecular Formula | C11H14N4 |
| Molecular Weight | 202.26 g/mol |
| Exact Mass | 202.12 |
| IUPAC Name | 2-cyclohexyl-7H-purine |
| SMILES | c1nc2nc(C3CCCCC3)ncc2[nH]1 |
| InChI | InChI=1S/C11H14N4/c1-2-4-8(5-3-1)10-12-6-9-11(15-10)14-7-13-9/h6-8H,1-5H2,(H,12,13,14,15) |
| InChIKey | SKMXEZQHTSOHMR-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.26 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-cyclohexyl-7H-purine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclohexyl-7H-purine?
The IUPAC name of 2-cyclohexyl-7H-purine (CID 70401170) is 2-cyclohexyl-7H-purine.
What is the SMILES notation for 2-cyclohexyl-7H-purine?
The canonical SMILES for 2-cyclohexyl-7H-purine is c1nc2nc(C3CCCCC3)ncc2[nH]1.
What is the InChIKey of 2-cyclohexyl-7H-purine?
The InChIKey is SKMXEZQHTSOHMR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N4/c1-2-4-8(5-3-1)10-12-6-9-11(15-10)14-7-13-9/h6-8H,1-5H2,(H,12,13,14,15).
What are the key properties of 2-cyclohexyl-7H-purine?
2-cyclohexyl-7H-purine has a molecular weight of 202.26 g/mol, XLogP of 2.40, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclohexyl-7H-purine is sourced from PubChem (CID 70401170), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).