About 1,1'-biphenyl;ethanol;ethoxyethane
1,1'-biphenyl;ethanol;ethoxyethane (PubChem CID 70401504) has the molecular formula C18H26O2
and a molecular weight of 274.40 g/mol. Its IUPAC name is 1,1'-biphenyl;ethanol;ethoxyethane.
Molecular Properties
| Compound Name | 1,1'-biphenyl;ethanol;ethoxyethane |
| PubChem CID | 70401504 |
| Molecular Formula | C18H26O2 |
| Molecular Weight | 274.40 g/mol |
| Exact Mass | 274.19 |
| IUPAC Name | 1,1'-biphenyl;ethanol;ethoxyethane |
| SMILES | CCO.CCOCC.c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C12H10.C4H10O.C2H6O/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;1-3-5-4-2;1-2-3/h1-10H;3-4H2,1-2H3;3H,2H2,1H3 |
| InChIKey | PUDJCAXEZUEBSP-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.40 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1,1'-biphenyl;ethanol;ethoxyethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1'-biphenyl;ethanol;ethoxyethane?
The IUPAC name of 1,1'-biphenyl;ethanol;ethoxyethane (CID 70401504) is 1,1'-biphenyl;ethanol;ethoxyethane.
What is the SMILES notation for 1,1'-biphenyl;ethanol;ethoxyethane?
The canonical SMILES for 1,1'-biphenyl;ethanol;ethoxyethane is CCO.CCOCC.c1ccc(-c2ccccc2)cc1.
What is the InChIKey of 1,1'-biphenyl;ethanol;ethoxyethane?
The InChIKey is PUDJCAXEZUEBSP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10.C4H10O.C2H6O/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;1-3-5-4-2;1-2-3/h1-10H;3-4H2,1-2H3;3H,2H2,1H3.
What are the key properties of 1,1'-biphenyl;ethanol;ethoxyethane?
1,1'-biphenyl;ethanol;ethoxyethane has a molecular weight of 274.40 g/mol, XLogP of 4.39, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1'-biphenyl;ethanol;ethoxyethane is sourced from PubChem (CID 70401504), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).