About 13,13-diethoxy-7-fluorodispiro[5.1.58.16]tetradecan-14-one
13,13-diethoxy-7-fluorodispiro[5.1.58.16]tetradecan-14-one (PubChem CID 70402146) has the molecular formula C18H29FO3
and a molecular weight of 312.43 g/mol. Its IUPAC name is 13,13-diethoxy-7-fluorodispiro[5.1.58.16]tetradecan-14-one.
Molecular Properties
| Compound Name | 13,13-diethoxy-7-fluorodispiro[5.1.58.16]tetradecan-14-one |
| PubChem CID | 70402146 |
| Molecular Formula | C18H29FO3 |
| Molecular Weight | 312.43 g/mol |
| Exact Mass | 312.21 |
| IUPAC Name | 13,13-diethoxy-7-fluorodispiro[5.1.58.16]tetradecan-14-one |
| SMILES | CCOC1(OCC)CCCCC12C(=O)C1(CCCCC1)C2F |
| InChI | InChI=1S/C18H29FO3/c1-3-21-18(22-4-2)13-9-8-12-17(18)14(19)16(15(17)20)10-6-5-7-11-16/h14H,3-13H2,1-2H3 |
| InChIKey | BCLJNOWSMDATND-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.43 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 13,13-diethoxy-7-fluorodispiro[5.1.58.16]tetradecan-14-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 13,13-diethoxy-7-fluorodispiro[5.1.58.16]tetradecan-14-one?
The IUPAC name of 13,13-diethoxy-7-fluorodispiro[5.1.58.16]tetradecan-14-one (CID 70402146) is 13,13-diethoxy-7-fluorodispiro[5.1.58.16]tetradecan-14-one.
What is the SMILES notation for 13,13-diethoxy-7-fluorodispiro[5.1.58.16]tetradecan-14-one?
The canonical SMILES for 13,13-diethoxy-7-fluorodispiro[5.1.58.16]tetradecan-14-one is CCOC1(OCC)CCCCC12C(=O)C1(CCCCC1)C2F.
What is the InChIKey of 13,13-diethoxy-7-fluorodispiro[5.1.58.16]tetradecan-14-one?
The InChIKey is BCLJNOWSMDATND-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H29FO3/c1-3-21-18(22-4-2)13-9-8-12-17(18)14(19)16(15(17)20)10-6-5-7-11-16/h14H,3-13H2,1-2H3.
What are the key properties of 13,13-diethoxy-7-fluorodispiro[5.1.58.16]tetradecan-14-one?
13,13-diethoxy-7-fluorodispiro[5.1.58.16]tetradecan-14-one has a molecular weight of 312.43 g/mol, XLogP of 4.19, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 13,13-diethoxy-7-fluorodispiro[5.1.58.16]tetradecan-14-one is sourced from PubChem (CID 70402146), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).