C26H49NO2 — CID 70402332
(E)-1-[2-(hydroxymethyl)piperidin-1-yl]-3,7,11,15-tetramethylhexadec-2-en-1-one (PubChem CID 70402332) has the molecular formula C26H49NO2 and a molecular weight of 407.68 g/mol. Its IUPAC name is (E)-1-[2-(hydroxymethyl)piperidin-1-yl]-3,7,11,15-tetramethylhexadec-2-en-1-one.
| Compound Name | (E)-1-[2-(hydroxymethyl)piperidin-1-yl]-3,7,11,15-tetramethylhexadec-2-en-1-one |
|---|---|
| PubChem CID | 70402332 |
| Molecular Formula | C26H49NO2 |
| Molecular Weight | 407.68 g/mol |
| Exact Mass | 407.38 |
| IUPAC Name | (E)-1-[2-(hydroxymethyl)piperidin-1-yl]-3,7,11,15-tetramethylhexadec-2-en-1-one |
| SMILES | C/C(=C\C(=O)N1CCCCC1CO)CCCC(C)CCCC(C)CCCC(C)C |
| InChI | InChI=1S/C26H49NO2/c1-21(2)11-8-12-22(3)13-9-14-23(4)15-10-16-24(5)19-26(29)27-18-7-6-17-25(27)20-28/h19,21-23,25,28H,6-18,20H2,1-5H3/b24-19+ |
| InChIKey | RVFRKTCJEVOYQS-LYBHJNIJSA-N |
| XLogP | 6.75 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.68 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|