C28H35F3O7 — CID 70402876
(3aS,4R,6aR)-6a-(oxan-2-yloxy)-4-[(E)-1-(oxan-2-yloxy)-4-[3-(trifluoromethyl)phenoxy]but-1-enyl]-3a,4,5,6-tetrahydro-3H-cyclopenta[b]furan-2-one (PubChem CID 70402876) has the molecular formula C28H35F3O7 and a molecular weight of 540.58 g/mol. Its IUPAC name is (3aS,4R,6aR)-6a-(oxan-2-yloxy)-4-[(E)-1-(oxan-2-yloxy)-4-[3-(trifluoromethyl)phenoxy]but-1-enyl]-3a,4,5,6-tetrahydro-3H-cyclopenta[b]furan-2-one.
| Compound Name | (3aS,4R,6aR)-6a-(oxan-2-yloxy)-4-[(E)-1-(oxan-2-yloxy)-4-[3-(trifluoromethyl)phenoxy]but-1-enyl]-3a,4,5,6-tetrahydro-3H-cyclopenta[b]furan-2-one |
|---|---|
| PubChem CID | 70402876 |
| Molecular Formula | C28H35F3O7 |
| Molecular Weight | 540.58 g/mol |
| Exact Mass | 540.23 |
| IUPAC Name | (3aS,4R,6aR)-6a-(oxan-2-yloxy)-4-[(E)-1-(oxan-2-yloxy)-4-[3-(trifluoromethyl)phenoxy]but-1-enyl]-3a,4,5,6-tetrahydro-3H-cyclopenta[b]furan-2-one |
| SMILES | O=C1C[C@H]2[C@H](/C(=C\CCOc3cccc(C(F)(F)F)c3)OC3CCCCO3)CC[C@@]2(OC2CCCCO2)O1 |
| InChI | InChI=1S/C28H35F3O7/c29-28(30,31)19-7-5-8-20(17-19)33-16-6-9-23(36-25-10-1-3-14-34-25)21-12-13-27(22(21)18-24(32)37-27)38-26-11-2-4-15-35-26/h5,7-9,17,21-22,25-26H,1-4,6,10-16,18H2/b23-9+/t21-,22+,25?,26?,27+/m1/s1 |
| InChIKey | FUECTZQXDNAPJJ-JTEMUKPTSA-N |
| XLogP | 6.11 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.58 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|