About 9-Butylpurine-2,6,8-trione
9-Butylpurine-2,6,8-trione (PubChem CID 70402910) has the molecular formula C9H10N4O3
and a molecular weight of 222.20 g/mol. Its IUPAC name is 9-butylpurine-2,6,8-trione.
Molecular Properties
| Compound Name | 9-Butylpurine-2,6,8-trione |
| PubChem CID | 70402910 |
| Molecular Formula | C9H10N4O3 |
| Molecular Weight | 222.20 g/mol |
| Exact Mass | 222.08 |
| IUPAC Name | 9-butylpurine-2,6,8-trione |
| SMILES | CCCCN1C2=NC(=O)NC(=O)C2=NC1=O |
| InChI | InChI=1S/C9H10N4O3/c1-2-3-4-13-6-5(10-9(13)16)7(14)12-8(15)11-6/h2-4H2,1H3,(H,12,14,15) |
| InChIKey | XCVBKPSODNCXQY-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 91.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | 438 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.20 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 9-Butylpurine-2,6,8-trione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-Butylpurine-2,6,8-trione?
The IUPAC name of 9-Butylpurine-2,6,8-trione (CID 70402910) is 9-butylpurine-2,6,8-trione.
What is the SMILES notation for 9-Butylpurine-2,6,8-trione?
The canonical SMILES for 9-Butylpurine-2,6,8-trione is CCCCN1C2=NC(=O)NC(=O)C2=NC1=O.
What is the InChIKey of 9-Butylpurine-2,6,8-trione?
The InChIKey is XCVBKPSODNCXQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N4O3/c1-2-3-4-13-6-5(10-9(13)16)7(14)12-8(15)11-6/h2-4H2,1H3,(H,12,14,15).
What are the key properties of 9-Butylpurine-2,6,8-trione?
9-Butylpurine-2,6,8-trione has a molecular weight of 222.20 g/mol, XLogP of 0.40, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 9-Butylpurine-2,6,8-trione is sourced from PubChem (CID 70402910), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).