C9H10N4O3 — CID 70402910
9-butylpurine-2,6,8-trione (PubChem CID 70402910) has the molecular formula C9H10N4O3 and a molecular weight of 222.20 g/mol. Its IUPAC name is 9-butylpurine-2,6,8-trione.
| Compound Name | 9-butylpurine-2,6,8-trione |
|---|---|
| PubChem CID | 70402910 |
| Molecular Formula | C9H10N4O3 |
| Molecular Weight | 222.20 g/mol |
| Exact Mass | 222.08 |
| IUPAC Name | 9-butylpurine-2,6,8-trione |
| SMILES | CCCCN1C(=O)N=C2C(=O)NC(=O)N=C21 |
| InChI | InChI=1S/C9H10N4O3/c1-2-3-4-13-6-5(10-9(13)16)7(14)12-8(15)11-6/h2-4H2,1H3,(H,12,14,15) |
| InChIKey | XCVBKPSODNCXQY-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 91.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.20 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |