C10H18N4O2 — CID 70403200
2-[(2S,5R)-2,5-dimethylpiperazin-1-yl]but-2-enediamide (PubChem CID 70403200) has the molecular formula C10H18N4O2 and a molecular weight of 226.28 g/mol. Its IUPAC name is 2-[(2S,5R)-2,5-dimethylpiperazin-1-yl]but-2-enediamide.
| Compound Name | 2-[(2S,5R)-2,5-dimethylpiperazin-1-yl]but-2-enediamide |
|---|---|
| PubChem CID | 70403200 |
| Molecular Formula | C10H18N4O2 |
| Molecular Weight | 226.28 g/mol |
| Exact Mass | 226.14 |
| IUPAC Name | 2-[(2S,5R)-2,5-dimethylpiperazin-1-yl]but-2-enediamide |
| SMILES | C[C@@H]1CN(C(=CC(N)=O)C(N)=O)[C@@H](C)CN1 |
| InChI | InChI=1S/C10H18N4O2/c1-6-5-14(7(2)4-13-6)8(10(12)16)3-9(11)15/h3,6-7,13H,4-5H2,1-2H3,(H2,11,15)(H2,12,16)/t6-,7+/m1/s1 |
| InChIKey | CUYMSEGQBNVLIM-RQJHMYQMSA-N |
| XLogP | -1.48 |
| TPSA | 101.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.28 |
| LogP ≤ 5 | -1.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|