C27H44N2O8 — CID 70403275
[(3R,4aS,5S,6S,6aS,10R,10aS,10bR)-5-carbamoyloxy-3-ethenyl-6,10-dihydroxy-3,4a,7,7,10a-pentamethyl-1-oxo-5,6,6a,8,9,10b-hexahydro-2H-benzo[f]chromen-10-yl] 2-(tert-butylamino)acetate (PubChem CID 70403275) has the molecular formula C27H44N2O8 and a molecular weight of 524.66 g/mol. Its IUPAC name is [(3R,4aS,5S,6S,6aS,10R,10aS,10bR)-5-carbamoyloxy-3-ethenyl-6,10-dihydroxy-3,4a,7,7,10a-pentamethyl-1-oxo-5,6,6a,8,9,10b-hexahydro-2H-benzo[f]chromen-10-yl] 2-(tert-butylamino)acetate.
| Compound Name | [(3R,4aS,5S,6S,6aS,10R,10aS,10bR)-5-carbamoyloxy-3-ethenyl-6,10-dihydroxy-3,4a,7,7,10a-pentamethyl-1-oxo-5,6,6a,8,9,10b-hexahydro-2H-benzo[f]chromen-10-yl] 2-(tert-butylamino)acetate |
|---|---|
| PubChem CID | 70403275 |
| Molecular Formula | C27H44N2O8 |
| Molecular Weight | 524.66 g/mol |
| Exact Mass | 524.31 |
| IUPAC Name | [(3R,4aS,5S,6S,6aS,10R,10aS,10bR)-5-carbamoyloxy-3-ethenyl-6,10-dihydroxy-3,4a,7,7,10a-pentamethyl-1-oxo-5,6,6a,8,9,10b-hexahydro-2H-benzo[f]chromen-10-yl] 2-(tert-butylamino)acetate |
| SMILES | C=C[C@@]1(C)CC(=O)[C@H]2[C@](C)(O1)[C@@H](OC(N)=O)[C@@H](O)[C@H]1C(C)(C)CC[C@@](O)(OC(=O)CNC(C)(C)C)[C@@]12C |
| InChI | InChI=1S/C27H44N2O8/c1-10-24(7)13-15(30)18-25(8)19(17(32)20(35-21(28)33)26(18,9)37-24)23(5,6)11-12-27(25,34)36-16(31)14-29-22(2,3)4/h10,17-20,29,32,34H,1,11-14H2,2-9H3,(H2,28,33)/t17-,18+,19-,20-,24-,25+,26-,27+/m0/s1 |
| InChIKey | URWKKENUUHRKMW-QBSFTSPQSA-N |
| XLogP | 2.20 |
| TPSA | 157.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.66 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|