About tert-butyl 4,5-diamino-2-(cyclohexylmethyl)-3-hydroxy-4-methoxy-5-oxopentanoate
tert-butyl 4,5-diamino-2-(cyclohexylmethyl)-3-hydroxy-4-methoxy-5-oxopentanoate (PubChem CID 70403292) has the molecular formula C17H32N2O5
and a molecular weight of 344.45 g/mol. Its IUPAC name is tert-butyl 4,5-diamino-2-(cyclohexylmethyl)-3-hydroxy-4-methoxy-5-oxopentanoate.
Molecular Properties
| Compound Name | tert-butyl 4,5-diamino-2-(cyclohexylmethyl)-3-hydroxy-4-methoxy-5-oxopentanoate |
| PubChem CID | 70403292 |
| Molecular Formula | C17H32N2O5 |
| Molecular Weight | 344.45 g/mol |
| Exact Mass | 344.23 |
| IUPAC Name | tert-butyl 4,5-diamino-2-(cyclohexylmethyl)-3-hydroxy-4-methoxy-5-oxopentanoate |
| SMILES | COC(N)(C(N)=O)C(O)C(CC1CCCCC1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H32N2O5/c1-16(2,3)24-14(21)12(10-11-8-6-5-7-9-11)13(20)17(19,23-4)15(18)22/h11-13,20H,5-10,19H2,1-4H3,(H2,18,22) |
| InChIKey | XNQHSMFWEADEFK-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 124.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.45 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 4,5-diamino-2-(cyclohexylmethyl)-3-hydroxy-4-methoxy-5-oxopentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 4,5-diamino-2-(cyclohexylmethyl)-3-hydroxy-4-methoxy-5-oxopentanoate?
The IUPAC name of tert-butyl 4,5-diamino-2-(cyclohexylmethyl)-3-hydroxy-4-methoxy-5-oxopentanoate (CID 70403292) is tert-butyl 4,5-diamino-2-(cyclohexylmethyl)-3-hydroxy-4-methoxy-5-oxopentanoate.
What is the SMILES notation for tert-butyl 4,5-diamino-2-(cyclohexylmethyl)-3-hydroxy-4-methoxy-5-oxopentanoate?
The canonical SMILES for tert-butyl 4,5-diamino-2-(cyclohexylmethyl)-3-hydroxy-4-methoxy-5-oxopentanoate is COC(N)(C(N)=O)C(O)C(CC1CCCCC1)C(=O)OC(C)(C)C.
What is the InChIKey of tert-butyl 4,5-diamino-2-(cyclohexylmethyl)-3-hydroxy-4-methoxy-5-oxopentanoate?
The InChIKey is XNQHSMFWEADEFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H32N2O5/c1-16(2,3)24-14(21)12(10-11-8-6-5-7-9-11)13(20)17(19,23-4)15(18)22/h11-13,20H,5-10,19H2,1-4H3,(H2,18,22).
What are the key properties of tert-butyl 4,5-diamino-2-(cyclohexylmethyl)-3-hydroxy-4-methoxy-5-oxopentanoate?
tert-butyl 4,5-diamino-2-(cyclohexylmethyl)-3-hydroxy-4-methoxy-5-oxopentanoate has a molecular weight of 344.45 g/mol, XLogP of 1.06, 7 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 4,5-diamino-2-(cyclohexylmethyl)-3-hydroxy-4-methoxy-5-oxopentanoate is sourced from PubChem (CID 70403292), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).