About 2-[4-(2-chlorophenyl)-3-ethyl-2-oxopyrimido[2,1-b][1,3]benzothiazol-8-yl]acetic acid
2-[4-(2-chlorophenyl)-3-ethyl-2-oxopyrimido[2,1-b][1,3]benzothiazol-8-yl]acetic acid (PubChem CID 70403725) has the molecular formula C20H15ClN2O3S
and a molecular weight of 398.87 g/mol. Its IUPAC name is 2-[4-(2-chlorophenyl)-3-ethyl-2-oxopyrimido[2,1-b][1,3]benzothiazol-8-yl]acetic acid.
Molecular Properties
| Compound Name | 2-[4-(2-chlorophenyl)-3-ethyl-2-oxopyrimido[2,1-b][1,3]benzothiazol-8-yl]acetic acid |
| PubChem CID | 70403725 |
| Molecular Formula | C20H15ClN2O3S |
| Molecular Weight | 398.87 g/mol |
| Exact Mass | 398.05 |
| IUPAC Name | 2-[4-(2-chlorophenyl)-3-ethyl-2-oxopyrimido[2,1-b][1,3]benzothiazol-8-yl]acetic acid |
| SMILES | CCc1c(-c2ccccc2Cl)n2c(nc1=O)sc1cc(CC(=O)O)ccc12 |
| InChI | InChI=1S/C20H15ClN2O3S/c1-2-12-18(13-5-3-4-6-14(13)21)23-15-8-7-11(10-17(24)25)9-16(15)27-20(23)22-19(12)26/h3-9H,2,10H2,1H3,(H,24,25) |
| InChIKey | ICVKVFXNGWMWQC-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 71.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 398.87 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[4-(2-chlorophenyl)-3-ethyl-2-oxopyrimido[2,1-b][1,3]benzothiazol-8-yl]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(2-chlorophenyl)-3-ethyl-2-oxopyrimido[2,1-b][1,3]benzothiazol-8-yl]acetic acid?
The IUPAC name of 2-[4-(2-chlorophenyl)-3-ethyl-2-oxopyrimido[2,1-b][1,3]benzothiazol-8-yl]acetic acid (CID 70403725) is 2-[4-(2-chlorophenyl)-3-ethyl-2-oxopyrimido[2,1-b][1,3]benzothiazol-8-yl]acetic acid.
What is the SMILES notation for 2-[4-(2-chlorophenyl)-3-ethyl-2-oxopyrimido[2,1-b][1,3]benzothiazol-8-yl]acetic acid?
The canonical SMILES for 2-[4-(2-chlorophenyl)-3-ethyl-2-oxopyrimido[2,1-b][1,3]benzothiazol-8-yl]acetic acid is CCc1c(-c2ccccc2Cl)n2c(nc1=O)sc1cc(CC(=O)O)ccc12.
What is the InChIKey of 2-[4-(2-chlorophenyl)-3-ethyl-2-oxopyrimido[2,1-b][1,3]benzothiazol-8-yl]acetic acid?
The InChIKey is ICVKVFXNGWMWQC-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H15ClN2O3S/c1-2-12-18(13-5-3-4-6-14(13)21)23-15-8-7-11(10-17(24)25)9-16(15)27-20(23)22-19(12)26/h3-9H,2,10H2,1H3,(H,24,25).
What are the key properties of 2-[4-(2-chlorophenyl)-3-ethyl-2-oxopyrimido[2,1-b][1,3]benzothiazol-8-yl]acetic acid?
2-[4-(2-chlorophenyl)-3-ethyl-2-oxopyrimido[2,1-b][1,3]benzothiazol-8-yl]acetic acid has a molecular weight of 398.87 g/mol, XLogP of 4.42, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(2-chlorophenyl)-3-ethyl-2-oxopyrimido[2,1-b][1,3]benzothiazol-8-yl]acetic acid is sourced from PubChem (CID 70403725), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).