C22H33F3O5 — CID 70403839
(1'S,2'R,3'R,6'R)-2'-[(E,3S)-3-cyclohexyl-3-hydroxyprop-1-enyl]-8'-methyl-6'-(2,2,2-trifluoroethoxy)spiro[1,3-dioxolane-2,7'-bicyclo[4.2.0]octane]-3'-ol (PubChem CID 70403839) has the molecular formula C22H33F3O5 and a molecular weight of 434.50 g/mol. Its IUPAC name is (1'S,2'R,3'R,6'R)-2'-[(E,3S)-3-cyclohexyl-3-hydroxyprop-1-enyl]-8'-methyl-6'-(2,2,2-trifluoroethoxy)spiro[1,3-dioxolane-2,7'-bicyclo[4.2.0]octane]-3'-ol.
| Compound Name | (1'S,2'R,3'R,6'R)-2'-[(E,3S)-3-cyclohexyl-3-hydroxyprop-1-enyl]-8'-methyl-6'-(2,2,2-trifluoroethoxy)spiro[1,3-dioxolane-2,7'-bicyclo[4.2.0]octane]-3'-ol |
|---|---|
| PubChem CID | 70403839 |
| Molecular Formula | C22H33F3O5 |
| Molecular Weight | 434.50 g/mol |
| Exact Mass | 434.23 |
| IUPAC Name | (1'S,2'R,3'R,6'R)-2'-[(E,3S)-3-cyclohexyl-3-hydroxyprop-1-enyl]-8'-methyl-6'-(2,2,2-trifluoroethoxy)spiro[1,3-dioxolane-2,7'-bicyclo[4.2.0]octane]-3'-ol |
| SMILES | CC1[C@@H]2[C@@H](/C=C/[C@@H](O)C3CCCCC3)[C@H](O)CC[C@]2(OCC(F)(F)F)C12OCCO2 |
| InChI | InChI=1S/C22H33F3O5/c1-14-19-16(7-8-17(26)15-5-3-2-4-6-15)18(27)9-10-20(19,30-13-21(23,24)25)22(14)28-11-12-29-22/h7-8,14-19,26-27H,2-6,9-13H2,1H3/b8-7+/t14?,16-,17+,18+,19+,20+/m0/s1 |
| InChIKey | SQTOTQXDKWUMJJ-BRFHYRQGSA-N |
| XLogP | 3.58 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.50 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|